Template:Infobox drug/testcases5#PDB ligand
{{Testcases notice}}
{{Drugbox/testcases/navbox}}
Drugbank
:URl change 2021-01-27
:{{t links|Infobox drug/formatDrugBank/sandbox}}
:{{t links|DrugBank/sandbox}}
UNII
:Dec 2020: talk [https://en.wikipedia.org/w/index.php?title=Template_talk:Infobox_drug&type=revision&diff=994506680&oldid=993712202&diffmode=source]
Aspirin R16CO5Y76E
:{{t links|Infobox drug/formatUNII}}
:{{Infobox drug/formatUNII|localValue=R16CO5Y76E}}
;sandbox
:{{Infobox drug/formatUNII/sandbox|localValue=R16CO5Y76E}}
PDB ligand
:Oct 2020, Template_talk:Infobox_drug#PDB
{{testcase table
| drug_name = Valganciclovir
| image = Valganciclovir structure.svg
| index2_label = [test]
| CAS_number = 175865-60-8
| CAS_supplemental =
| PubChem = 135413535
| IUPHAR_ligand = 4716
| DrugBank = DB01610
| ChemSpiderID = 57721
| UNII = GCU97FKN3R
| KEGG = D02495
| KEGG2 = D03256
| ChEBI =
| ChEMBL = 1201314
| NIAID_ChemDB = 032967
| PDB_ligand = F9E
| PDB_ligand2 = TYL
| SMILES = O=C(OCC(OCn1c2N\C(=N/C(=O)c2nc1)N)CO)[C@@H](N)C(C)C
| StdInChI = 1S/C14H22N6O5/c1-7(2)9(15)13(23)24-4-8(3-21)25-6-20-5-17-10-11(20)18-14(16)19-12(10)22/h5,7-9,21H,3-4,6,15H2,1-2H3,(H3,16,18,19,22)/t8?,9-/m0/s1
| StdInChIKey = WPVFJKSGQUFQAP-GKAPJAKFSA-N
}}
KEGG
{{testcase table
| drug_name = ID's
| Verifiedfields = changed
| verifiedrevid = 415028406
| CAS_number_Ref =
| CAS_number = 165800-03-3
| DrugBank =
| DrugBank_Ref =
| ChemSpiderID_Ref =
| ChemSpiderID = 390139
| UNII_Ref =
| UNII = ISQ9I6J12J
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| ChEMBL_Ref =
| ChEMBL = 126
| ChEBI_Ref =
| ChEBI = 127
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N
| ATC_prefix = J01
| ATC_suffix = XX08
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
|PubChem=4091
|PubChemSubstance=10099
}}
Test 1
{{testcase table
| drug_name = ID's
| Verifiedfields = changed
| verifiedrevid = 415028406
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| DrugBank = DB00601
| DrugBank_Ref = {{drugbankcite|monkey|??}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390139
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| ChEMBL_Ref = {{ebicite|correct|EBI1}}
| ChEMBL = 126
| ChEBI_Ref = {{ebicite|correct|EBI2}}
| ChEBI = 127
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N
| ATC_prefix = J01
| ATC_suffix = XX08
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
|PubChem=4091
|PubChemSubstance=10099
}}
id's indexed <blank>,2 with index 0, 2
{{purge}}
{{testcase table
| index_label=ix0
| index2_label=ix2
| index_comment=Some general note about index_label
| index2_comment=Some general note about index2_label
| IUPAC_name =Aaa
| IUPAC_name2 =Bbb
| drug_name = ID's with index2_label
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| CAS_number2 = 165800-03-2
| DrugBank = DB00601
| DrugBank2 = DB00602
| DrugBank_Ref = {{drugbankcite|monkey|??}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390139
| ChemSpiderID2 = 390132
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| UNII2 = ISQ9I6J122
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| KEGG2 = D00942
| ChEMBL_Ref = {{ebicite|correct|EBI1}}
| ChEMBL = 126
| ChEMBL2 = 1262
| ChEBI_Ref = {{ebicite|correct|EBI2}}
| ChEBI = 127
| ChEBI2 = 1272
| IUPHAR_ligand = 1133
| IUPHAR_ligand2 = 1132
| SMILES = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| SMILES2 = O=C22[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N
| StdInChI2 = 1S/22C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2
| StdInChIKey2 = 22ZROVQLWOKYKF-ZDUSSCGKSA-2
| ATC_prefix = J01
| ATC_suffix = XX08
| ATC_prefix2 = J02
| ATC_suffix2 = XX02
| NIAID_ChemDB = 070944
| NIAID_ChemDB2 = 070922
| PDB_ligand = ZLD
| PDB_ligand2 = ZLD2
| PubChem=4091
| PubChem2=4092
| PubChemSubstance=10099
| E_number=E111
| E_number2=E222
}}
index-2
{{purge}}
{{testcase table
| IUPAC_name =Aaa
| IUPAC_name2 =Bbb
| drug_name = ID's with index2_label
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| CAS_number2 = 165800-03-2
| DrugBank = DB00601
| DrugBank2 = DB00602
| DrugBank_Ref = {{drugbankcite|monkey|??}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390139
| ChemSpiderID2 = 390132
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ISQ9I6J12J
| UNII2 = ISQ9I6J122
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00947
| KEGG2 = D00942
| ChEMBL_Ref = {{ebicite|correct|EBI1}}
| ChEMBL = 126
| ChEMBL2 = 1262
| ChEBI_Ref = {{ebicite|correct|EBI2}}
| ChEBI = 127
| ChEBI2 = 1272
| IUPHAR_ligand = 1133
| IUPHAR_ligand2 = 1132
| SMILES = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| SMILES2 = O=C22[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = TYZROVQLWOKYKF-ZDUSSCGKSA-N
| StdInChI2 = 1S/22C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2
| StdInChIKey2 = 22ZROVQLWOKYKF-ZDUSSCGKSA-2
| ATC_prefix = J01
| ATC_suffix = XX08
| ATC_prefix2 = J02
| ATC_suffix2 = XX02
| NIAID_ChemDB = 070944
| NIAID_ChemDB2 = 070922
| PDB_ligand = ZLD
| PDB_ligand2 = ZLD2
| PubChem=4091
| PubChem2=4092
| PubChemSubstance=10099
| E_number=E111
| E_number2=E222
}}
index-2 only
{{purge}}
{{testcase table
| IUPAC_name2 =Bbb
| drug_name = ID's with index2_label
| index2_label=Indx2
| CAS_number2 = 165800-03-2
| DrugBank2 = DB00602
| ChemSpiderID2 = 390132
| UNII2 = ISQ9I6J122
| KEGG2 = D00942
| ChEMBL2 = 1262
| ChEBI2 = 1272
| IUPHAR_ligand2 = 1132
| SMILES2 = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc2
| StdInChI2 = 1S/C16H20FN3O4/c1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/h2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/t13-/m0/s2
| StdInChIKey2 = TYZROVQLWOKYKF-ZDUSSCGKSA-2
| ATC_prefix2 = J01
| ATC_suffix2 = XX08
| NIAID_ChemDB2 = 070942
| PDB_ligand2 = ZLD2
| PubChem2=4092
}}
Linalool
=Chembox=
{{clear}}
:{{para|index_label|}}
:{{para|index1_label|(R)}}
:{{para|index2_label|(S)}}
:{{para|CASNo1_Comment | (R)}}
:{{para|PubChem1_Comment | (R)}}
:{{para|CASNo2_Comment | (S)}}
:{{para|PubChem2_Comment | (S)}}
{{clear}}
{{chembox
|Name=Linalool (sandbox)
|Section1={{Chembox Identifiers/sandbox
| index_label =
| index1_label = (R)
| index2_label = (S)
| IUPHAR_ligand = 2469
| CASNo = 78-70-6
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 126-91-0
| CASNo1_Comment =
| CASNo1_Ref = {{cascite|changed|CAS}}
| CASNo2 = 126-90-9
| CASNo2_Comment =
| CASNo2_Ref = {{cascite|changed|CAS}}
| PubChem = 6549
| PubChem1 = 443158
| PubChem1_Comment =
| PubChem2 = 67179
| PubChem2_Comment = }}
| show_ss_note =no | show_infobox_ref =no
}}
{{chembox
|Name=Linalool (live version)
|Section1={{Chembox Identifiers
| index_label =
| index1_label = (R)
| index2_label = (S)
| IUPHAR_ligand = 2469
| CASNo = 78-70-6
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo1 = 126-91-0
| CASNo1_Comment = (R)
| CASNo1_Ref = {{cascite|changed|CAS}}
| CASNo2 = 126-90-9
| CASNo2_Comment = (S)
| CASNo2_Ref = {{cascite|changed|CAS}}
| PubChem = 6549
| PubChem1 = 443158
| PubChem1_Comment = (R)
| PubChem2 = 67179
| PubChem2_Comment = (S) }}
| show_ss_note =no | show_infobox_ref =no
}}
{{clear}}
: {{Q|Q410932}}, {{Q|Q27105233}}, {{Q|Q27105200}}
=Linalool by drugbox=
:index1 (R): skipped/unused
{{testcase table
|index_label=
|index1_label=(R)
|index2_label=(S)
|QID=Q410932
|QID1=Q27105233
|QID2=Q27105200
| IUPHAR_ligand = 2469
| CAS_number = 78-70-6
| CAS_number1 = 126-91-0
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number2 = 126-90-9
| CAS_number2_Ref = {{cascite|changed|CAS}}
| PubChem = 6549
| PubChem1 = 443158
| PubChem2 = 67179
}}
Test 2
:SID and CID
{{testcase table
| drug_name = ID's
| Verifiedfields = changed
| verifiedrevid = 415028406
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| ATC_prefix = J01
| ATC_suffix = XX08
| PubChem = 441401
| PubChemStructure=9999
| NIAID_ChemDB = 070944
| PDB_ligand = ZLD
|PubChemSubstance=10099
}}
data page
:{{para|data_page}} or exists, demo page = ???
{{testcase table
| drug_name = data page
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 165800-03-3
| data_page= some page
}}
CAS = none
:{{para|CAS_number|none}}
{{testcase table
| drug_name = regular cas
| CAS_number = 165800-03-3
| CAS_number_Ref = {{cascite|correct|??}}
}}
{{testcase table
| drug_name = cas none
| CAS_number = None
| CAS_number_Ref = {{cascite|correct|??}}
}}
{{testcase table
| drug_name = cas none
| CAS_number = None
| CAS_number2 = None
| CAS_number_Ref = {{cascite|correct|??}}
}}
{{testcase table
| drug_name = cas blank
| CAS_number =
| CAS_number_Ref = {{cascite|correct|??}}
}}
PubChem = none
:{{para|PubChem|none}}
{{testcase table
| drug_name = regular pubchem
| PubChem = 1234
}}
{{testcase table
| drug_name = pubchem none
| PubChem = None
}}
{{testcase table
| drug_name = pubchem2 none
| PubChem = None
| PubChem2 = none
}}
{{testcase table
| drug_name = pubchem blank
| PubChem =
}}
ChemSpider = none
:{{para|ChemSpiderID|none}} does cat, and show.
{{testcase table
| drug_name = deprecated chemspider =NA
| ChemSpiderID = Na
}}
{{testcase table
| drug_name = regular chemspider
| ChemSpiderID = 1234
}}
{{testcase table
| drug_name = rgular 2
| index_label=ix0
| index2_label=ix2
| ChemSpiderID = 789
| ChemSpiderID2 = 123
}}
{{testcase table
| drug_name = Chemspider none
| ChemSpiderID = None
}}
{{testcase table
| drug_name = 2 none
| index_label=ix0
| index2_label=ix2
| ChemSpiderID = None
| ChemSpiderID2 = 123
}}
{{testcase table
| drug_name = 2 none
| index_label=ix0
| index2_label=ix2
| ChemSpiderID = None
| ChemSpiderID2 = none
}}
{{testcase table
| drug_name = chemspider blank
| ChemSpiderID =
| index_label=ix0
| index2_label=ix2
}}
[http://www.example.com link title]
Jmol
1. By default, the Jmol external link is fed with the {{para|SMILES}} input. So {{para|Jmol}} does not need input.
2. When {{para|Jmol|none}}, the Jmol data row is suppressed (not shown).
3. When {{para|Jmol|<some SMILES string>}}, Jmol links will show that string in 3D, no matter what {{para|SMILES}} is. (SMILES output itself is unchanged).
{{testcase table
| drug_name = 1.Jmol by smiles (default)
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
}}
{{testcase table
| drug_name = 2.Jmol=none
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| Jmol = none
}}
{{testcase table
| drug_name = 3.Jmol=DDT (overwrites SMILES)
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| Jmol=Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
}}
{{testcase table
| drug_name = 4.Jmol only
| Jmol=Clc1ccc(cc1)C(c2ccc(Cl)cc2)C(Cl)(Cl)Cl
}}
=Jmol (secondary tests)=
{{testcase table
| drug_name = no input
| smiles =
}}
{{testcase table
| drug_name = Jmol=None
| smiles = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
| Jmol = None
}}
{{testcase table
| drug_name = SMILES2 input
| smiles2 = O=C1O[C@@H](CNC(=O)C)CN1c3cc(F)c(N2CCOCC2)cc3
}}