Tephrosin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 413150531

| ImageFile = Tephrosin.png

| ImageSize = 200px

| IUPACName = 7a-Hydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3H,7aH-pyrano[2,3-c;6,5-f']dichromen-7-one

| OtherNames = 12aβ-hydroxydeguelin{{cite journal| last=Cabizza | first=Maddalena |author2=Alberto Angioni |author3=Marinella Melis |author4=Marco Cabras |author5=Carlo V. Tuberoso |author6=Paolo Cabras | year=2004 | title=Rotenone and rotenoids in cubè resins, formulations, and residues on olives | journal=Journal of Agricultural and Food Chemistry | volume=52 | issue=2 | pages=288–293 | doi=10.1021/jf034987a| pmid=14733510| bibcode=2004JAFC...52..288C }}

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 76-80-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9C081V83CC

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 9442

| PubChem = 114909

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 241806

| SMILES = CC1(C=CC2=C(O1)C=CC3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@]4(C3=O)O)OC)OC)C

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 102858

| InChI = 1/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1

| InChIKey = AQBZCCQCDWNNJQ-AUSIDOKSBD

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = AQBZCCQCDWNNJQ-AUSIDOKSSA-N

| RTECS =

| MeSHName =

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C10535

}}

|Section2={{Chembox Properties

| Formula = C₂₃H₂₂O₇

| MolarMass = 410.41658 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds = Deguelin, toxicarol}}

}}

Tephrosin is rotenoid. It is a natural fish poison found in the leaves and seeds of Tephrosia purpurea{{cite journal| last=Ahmad | first=V. U. |author2=Z. Ali |author3=S. R. Hussaini |author4=F. Iqbal |author5=M. Zahid |author6=M. Abbas |author7=N. Saba | date=1999-08-01 | title=Flavonoids of Tephrosia purpurea | journal=Fitoterapia | volume=70 | issue=4 | pages=443–445 | doi=10.1016/S0367-326X(99)00046-5}} and T. vogelii.Production of rotenoids by heterotrophic and photomixotrophic cell cultures of tephrosia vogelii. Nadine Lambert, Marie-France Trouslot, Claudine Nef-Campa and Hervé Chrestin, Phytochemistry, Volume 34, Issue 6, December 1993, Pages 1515-1520, {{doi|10.1016/S0031-9422(00)90838-0}}