Terizidone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470602455

| IUPAC_name = 4,4'-{1,4-Phenylenebis[(E)methylylidene
(E)azanylylidene]}bis(1,2-oxazolidin-3-one)

| image = Terizidone.svg

| width = 275

| tradename =

| Drugs.com = {{drugs.com|international|terizidone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category = C

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 25683-71-0

| ATC_prefix = J04

| ATC_suffix = AK03

| PubChem = 65720

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 59144

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1199LEX5N8

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07247

| C=14 | H=14 | N=4 | O=4

| smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ODKYYBOHSVLGNU-IAGONARPSA-N

| synonyms = 4-[({4-[N-(3-oxo-1,2-oxazolidin-4-yl)carboximidoyl]phenyl}methylidene)amino]-1,2-oxazolidin-3-one

}}

Terizidone is a drug used in the treatment of tuberculosis.{{cite journal | vauthors = Galietti F, Giorgis GE, Oliaro A, Boaro D, Ardizzi A, Barberis S, Massaglia GM | title = [Tolerability to terizidone (TZ) in the treatment of pulmonary tuberculosis in dialyzed patients] | journal = Minerva Medica | volume = 82 | issue = 7–8 | pages = 477–81 | year = 1991 | pmid = 1922892 }} Terizidone is mainly used in multi-drug-resistant tuberculosis (MDR-TB) in conjunction with other second-line drugs. It is a derivate of cycloserine and it is bacteriostatic.{{Cite book|title = South African Medicines Formulary|last = Rossiter|first = Dawn | name-list-style = vanc |publisher = Health and Medical Publishing Group of the South African Medical Association|year = 2012|isbn = 978-1-875098-28-6|location = Cape Town, South Africa|pages = 323–325}}

References

{{reflist}}

{{Antimycobacterials}}

Category:Imines

Category:Isoxazolidinones

Category:Anti-tuberculosis drugs

{{antiinfective-drug-stub}}