Terizidone
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470602455
| IUPAC_name = 4,4'-
(E)azanylylidene]}bis(1,2-oxazolidin-3-one)
| image = Terizidone.svg
| width = 275
| tradename =
| Drugs.com = {{drugs.com|international|terizidone}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category = C
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 25683-71-0
| ATC_prefix = J04
| ATC_suffix = AK03
| PubChem = 65720
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 59144
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1199LEX5N8
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07247
| C=14 | H=14 | N=4 | O=4
| smiles = O=C3NOCC3/N=C/c2ccc(/C=N/C1C(=O)NOC1)cc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = ODKYYBOHSVLGNU-IAGONARPSA-N
| synonyms = 4-[({4-[N-(3-oxo-1,2-oxazolidin-4-yl)carboximidoyl]phenyl}methylidene)amino]-1,2-oxazolidin-3-one
}}
Terizidone is a drug used in the treatment of tuberculosis.{{cite journal | vauthors = Galietti F, Giorgis GE, Oliaro A, Boaro D, Ardizzi A, Barberis S, Massaglia GM | title = [Tolerability to terizidone (TZ) in the treatment of pulmonary tuberculosis in dialyzed patients] | journal = Minerva Medica | volume = 82 | issue = 7–8 | pages = 477–81 | year = 1991 | pmid = 1922892 }} Terizidone is mainly used in multi-drug-resistant tuberculosis (MDR-TB) in conjunction with other second-line drugs. It is a derivate of cycloserine and it is bacteriostatic.{{Cite book|title = South African Medicines Formulary|last = Rossiter|first = Dawn | name-list-style = vanc |publisher = Health and Medical Publishing Group of the South African Medical Association|year = 2012|isbn = 978-1-875098-28-6|location = Cape Town, South Africa|pages = 323–325}}