Testosterone furoate

{{Short description|Androgen and anabolic steroid}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (1S,2R,10R,11S,14S,15S)-2,15-dimethyl-5-oxotetracyclo[8.7.0.0^2,7.0^11,15]heptadec-6-en-14-yl furan-2-carboxylate

| image = Testosterone furoate.svg

| width = 250px

| tradename = Furotest

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 60895-85-4

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2ZF5A2M4J6

| ATC_prefix =

| ATC_suffix =

| PubChem =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID = 58539761

| synonyms = Testosterone 17β-(2-furoate); Testosterone 17β-(2-furoic acid); Testosterone furanate; 3-Oxoandrost-4-en-17β-yl 2-furoate

| C=24 | H=30 | O=4

| SMILES = C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34C)[C@@H]1CC[C@@H]2OC(=O)c5occc5

| StdInChI_Ref =

| StdInChI = 1S/C24H30O4/c1-23-11-9-16(25)14-15(23)5-6-17-18-7-8-21(24(18,2)12-10-19(17)23)28-22(26)20-4-3-13-27-20/h3-4,13-14,17-19,21H,5-12H2,1-2H3/t17-,18-,19-,21-,23-,24-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = GGOXAZFFJDKPQA-QRPBXLKNSA-N

}}

Testosterone furoate (brand name Furotest), also referred to as testosterone furanate in some publications,{{cite journal | vauthors = Hamburger C | title = Testosterone treatment and 17-ketosteroid excretion. IV. Administration of testosterone beta-cyclopentylpropionate, testosterone furanate, and testosterone oenanthate | journal = Acta Endocrinol | volume = 22 | issue = 4 | pages = 379–89 | date = August 1956 | pmid = 13354228 | doi = 10.1530/acta.0.0220379 | url = }}{{cite journal | vauthors = Hamburger C | title = Administrationsmadens Betydning ved Testosteronbehandling | trans-title = Significance of the mode of administration of testosterone preparations | language = Danish | journal = Manedsskr Prakt Laegegern | volume = 37 | issue = 5 | pages = 181–99 | date = May 1959 | pmid = 13666078 | doi = | url = }} is an androgen and anabolic steroid and a testosterone ester which is no longer marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA641|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=641–642}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA976|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA270|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1}}