Testosterone sulfate

{{Chembox

| ImageFile = Testosterone_sulfate.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 3-Oxoandrost-4-en-17β-yl hydrogen sulfate

| SystematicName = (1S,3aS,3bR,9aR,9bS,11aS)-9a,11a-Dimethyl-7-oxo-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl hydrogen sulfate

| OtherNames = Testosterone 17β-sulfate; Testosterone 17β-sulfuric acid; 17β-(Sulfooxy)androst-4-en-3-one

| Section1 = {{Chembox Identifiers

| CASNo = 651-45-6

| ChemSpiderID = 106493

| ChEBI = 84094

| ChEMBL =

| KEGG =

| PubChem = 119207

| StdInChI = 1S/C19H28O5S/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(24-25(21,22)23)19(15,2)10-8-16(14)18/h11,14-17H,3-10H2,1-2H3,(H,21,22,23)/t14-,15-,16-,17-,18-,19-/m0/s1

| StdInChIKey = WAQBISPOEAOCOG-DYKIIFRCSA-N

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OS(=O)(=O)O)CCC4=CC(=O)CC[C@]34C

| UNII =

}}

| Section2 = {{Chembox Properties

| C=19 | H=28 | O=5 | S=1

| MolarMass = 368.488 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Testosterone sulfate is an endogenous, naturally occurring steroid and minor urinary metabolite of testosterone.{{cite HMDB|author1-link=David S. Wishart|url=http://www.hmdb.ca/metabolites/hmdb02833|title=Showing metabocard for Testosterone sulfate (HMDB02833)}}