Tetrahydrocarbazole

{{Chembox

| ImageFile = Tetrahydrocarbazole.svg

| ImageSize =

| ImageAlt =

| IUPACName = 2,3,4,9-tetrahydro-1H-carbazole

| OtherNames = 1,2,3,4-Tetrahydrocarbazole

| Section1 = {{Chembox Identifiers

| CASNo = 942-01-8

| EC_number = 213-385-7

| PubChem = 13664

| SMILES = C1CCC2=C(C1)C3=CC=CC=C3N2

| InChI = 1S/C12H13N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1,3,5,7,13H,2,4,6,8H2

| InChIKey = XKLNOVWDVMWTOB-UHFFFAOYSA-N

| ChemSpiderID = 13075

| UNII = 8ZLK0TSX93

| ChEMBL = 1911317

}}

| Section2 = {{Chembox Properties

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Tetrahydrocarbazole is a heterocyclic compound featuring a fused structure composed of a five-membered pyrrole ring, a benzene ring, and a cyclohexane ring, making it a partially saturated derivative of carbazole.{{cite journal | vauthors = Chakroborty S, Panda P | title = A comprehensive overview of the synthesis of tetrahydrocarbazoles and its biological properties. | journal = Mini-Reviews in Organic Chemistry | date = September 2021 | volume = 18 | issue = 6 | pages = 709–718 | doi = 10.2174/1570193X17999200820163532 }} This molecular framework is commonly found in natural products and serves as a scaffold in medicinal chemistry due to its diverse pharmacological activities, including antimicrobial, anticancer, antipsychotic, and anti-inflammatory properties.

Examples of drugs that contain the tetrahydrocarbazole ring system include ondansetron and ramatroban.