Tetrahydrocoptisine

{{Chembox

| ImageFile = Tetrahydrocoptisine.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName =

| OtherNames = Stylopine

|Section1={{Chembox Identifiers

| CASNo = 4312-32-7

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J0JS75Q12Z

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C05175

| PubChem = 6770

| ChemSpiderID = 6512

| SMILES = C1CN2CC3=C(CC2C4=CC5=C(C=C41)OCO5)C=CC6=C3OCO6

}}

|Section2={{Chembox Properties

| C=19 | H=17 | N=1 | O=4

| Formula =

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Tetrahydrocoptisine (also known as stylopine) is an alkaloid isolated from Corydalis impatiens.{{cite journal | pmid = 23810685 | year = 2013 | last1 = Li | first1 = W. | last2 = Huang | first2 = H. | last3 = Zhang | first3 = Y. | last4 = Fan | first4 = T. | last5 = Liu | first5 = X. | last6 = Xing | first6 = W. | last7 = Niu | first7 = X. | title = Anti-inflammatory effect of tetrahydrocoptisine from Corydalis impatiens is a function of possible inhibition of TNF-α, IL-6 and NO production in lipopolysaccharide-stimulated peritoneal macrophages through inhibiting NF-κB activation and MAPK pathway | journal = European Journal of Pharmacology | volume = 715 | issue = 1–3 | pages = 62–71 | doi = 10.1016/j.ejphar.2013.06.017 }}