Tetramethrin

{{chembox

| Watchedfields = changed

| verifiedrevid = 470604751

| Name = Tetramethrin

| ImageFile1 = Tetramethrin-stereoisomers-2D-skeletal.png

| ImageSize1 =

| ImageName1 = Tetramethrin

| ImageFile2 = Tetramethrin 3D.png

| ImageSize2 =

| ImageName2 = 3D model

| IUPACName = (1,3-Dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate

| PIN = (1,3-Dioxo-1,3,4,5,6,7-hexahydro-2H-isoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 75773

| PubChem = 83975

| EINECS = 214-619-0

| RTECS = GZ1730000

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07368

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Z72930Q46K

| InChI = 1/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3

| InChIKey = CXBMCYHAMVGWJQ-UHFFFAOYAA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CXBMCYHAMVGWJQ-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 7696-12-0

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 39397

| SMILES = O=C1\C3=C(/C(=O)N1COC(=O)C2C(\C=C(/C)C)C2(C)C)CCCC3

}}

|Section2={{Chembox Properties

| Formula = C₁₉H₂₅NO₄

| MolarMass = 331.406 g/mol

| Appearance = white crystalline solid

| Odor = strong, pyrethrum-like

| Density = 1.108 g/cm³

| MeltingPtC = 65 to 80

| MeltingPt_notes =

| BoilingPt =

| Solubility = 0.00183 g/100 mL

| SolubleOther = soluble in methane, hexane
slightly soluble in acetone, n-octanol, ethanol
very slightly soluble in xylene

| VaporPressure = 10 Pa

| LogP = 4.73

| RefractIndex = 1.5175

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = P03

| ATCCode_suffix = BA04

| ATC_Supplemental = {{ATCvet|P53|AC13}}

}}

|Section7={{Chembox Hazards

| LD50 = 20,000 mg/kg (rat, oral)

}}

}}

Tetramethrin is a potent synthetic insecticide in the pyrethroid family. It is a white crystalline solid with a melting point of 65–80 °C. The commercial product is a mixture of stereoisomers.

It is commonly used as an insecticide, and affects the insect's nervous system. It is found in many household insecticide products.{{CPID|id=596}}

Tetramethrin has an expected half-life of 12.5–14 days in soil and 13–25 days in water.{{cite web |title=Re-evaluation Decision RVD2018-01, Tetramethrin and Its Associated End-use Products |date=23 February 2018 |url=https://www.canada.ca/en/health-canada/services/consumer-product-safety/reports-publications/pesticides-pest-management/decisions-updates/reevaluation-decision/2018/tetramethrin.html}} Tetramethrin was classified as a Category 2 carcinogen in 2018 by Directorate-General for the Environment of the European Commission.{{cite web |title=Commission Regulation (EU) 2018/1480 of 4 October 2018 amending, for the purposes of its adaptation to technical and scientific progress, Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixtures and correcting Commission Regulation (EU) 2017/776 (Text with EEA relevance.) |date=4 October 2018 |url=https://op.europa.eu/en/publication-detail/-/publication/fe49a71c-c862-11e8-9424-01aa75ed71a1}}