Tetramethylammonium perchlorate

{{Chembox

| Name = Tetramethylammonium perchlorate

| OtherNames =

| ImageFile = Tetramethylammonium perchlorate.svg

| Section1 = {{Chembox Identifiers

| CASNo = 2537-36-2

| CASNo_Ref = {{cascite|correct|CAS}}

| ChemSpiderID = 16407

| EC_number = 219-805-5

| PubChem = 17337

| StdInChI=1S/C4H12N.ClHO4/c1-5(2,3)4;2-1(3,4)5/h1-4H3;(H,2,3,4,5)/q+1;/p-1

| StdInChIKey = ZCWKIFAQRXNZCH-UHFFFAOYSA-M

| SMILES = C[N+](C)(C)C.[O-]Cl(=O)(=O)=O

}}

| Section2 = {{Chembox Properties

| Formula = (CH3)4NClO4

| MolarMass =

| Appearance = White Crystal Powder[https://www.chemicalbook.com/ProductChemicalPropertiesCB1211863_EN.htm TETRAMETHYLAMMONIUM PERCHLORATE CAS#: 2537-36-2 (chemicalbook.com) ]. Chemical Book. [2018-3-14]

| Density =

| Solubility =

| MeltingPt = 300 °C

}}

| Section7 = {{Chembox Hazards

| GHSPictograms = {{GHS03}}{{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|272|300|311|315|319|335|370|373|411}}

| PPhrases = {{P-phrases|210|220|221|260|261|264|270|271|273|280|301+310|302+352|304+340|305+351+338|307+311|312|314|321|322|330|332+313|337+313|361|362|363|370+378|391|403+233|405|501}}

| NFPA-H = 2

| NFPA-F = 1

| NFPA-I = 3

| NFPA-S = OX

}}

}}

Tetramethylammonium perchlorate is a perchlorate salt with a condensed formula [N(CH3)4]+ClO4.

Preparation

Tetramethylammonium perchlorate can be produced by mixing cold, dilute perchloric acid with cold tetramethylammonium hydroxide, the reaction will lead to a white precipitation.{{cite journal |last1=Juknelevicius |first1=Dominykas |last2=Dufter |first2=Alicia |last3=Rusan |first3=Magdalena |last4=Klapötke |first4=Thomas M. |last5=Ramanavicius |first5=Arunas |title=Study of Pyrotechnic Blue Strobe Compositions Based on Ammonium Perchlorate and Tetramethylammonium Nitrate: Study of Pyrotechnic Blue Strobe Compositions Based on Ammonium Perchlorate and Tetramethylammonium Nitrate |journal=European Journal of Inorganic Chemistry |date=2017-02-17 |volume=2017 |issue=7 |pages=1113–1119 |doi=10.1002/ejic.201601486|doi-access=free }}

Uses

The perchlorate is used as an intermediate in organic synthesis, in chromatography and as a supporting electrolyte in electrochemistry.{{cite web | url=https://www.alfa.com/ru/catalog/030834 | title=2537-36-2 - Tetramethylammonium perchlorate - 30834 - Alfa Aesar }} Along with trimethylammonium perchlorate, it was investigated as a component in composite propellants during the Cold War, but without much success.

References

{{Reflist}}

Further reading

  • Hofmann, K. A.; Roth, R.; Hobold, K.; Metzler, A. Relationship between the Constitution and Behavior towards Water of Ammonium Oxonium Perchlorates. Berichte der Deutschen Chemischen Gesellschaft, 1911. 43: 2624-2630. {{ISSN|0365-9496}}

{{Inorganic-compound-stub}}

Category:Perchlorates

Category:Tetramethylammonium salts