Tetraphenylene

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 413769870

| Reference = [http://www.sigmaaldrich.com/catalog/search/ProductDetail/ALDRICH/379328 Tetraphenylene] at Sigma-Aldrich

| Name = Tetraphenylene

| ImageFile = Tetraphenylene.svg

| ImageSize = 150px

| ImageName = Skeletal formula

| ImageFile1 = Tetraphenylene-3D-spacefill.png

| ImageSize1 =

| ImageName1 = Space-filling model

| PIN = Tetraphenylene{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=209 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}

|Section1={{Chembox Identifiers

| CASNo = 212-74-8

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 887R8CZW6Z

| PubChem = 2724868

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2006983

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C24H16/c1-2-10-18-17(9-1)19-11-3-4-13-21(19)23-15-7-8-16-24(23)22-14-6-5-12-20(18)22/h1-16H/b19-17-,20-18-,23-21-,24-22-

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KTQYWNARBMKMCX-LEYBOLSUSA-N

| SMILES = C1=CC=C2C(=C1)C3=CC=CC=C3C4=CC=CC=C4C5=CC=CC=C25

}}

|Section2={{Chembox Properties

| Formula = C₂₄H₁₆

| MolarMass = 304.39 g/mol

| MeltingPtC = 232 to 235

| MeltingPt_notes =

| BoilingPtC = 577.6

| BoilingPt_notes = at 760 mmHg

| Density = 1.19 g/cm3

}}

|Section7={{Chembox Hazards

| FlashPtC = 297.9

}}

|Section8={{Chembox Structure

| Dipole = 0 D

| PointGroup = D_2d

}}

}}

Tetraphenylene is an organic compound, solid at room temperature, with the chemical formula C₂₄H₁₆. It is a member of the unsaturated polycyclic hydrocarbons class of compounds and a tetramer of benzyne.