Theasinensin B
{{Short description|Chemical compound}}
{{Chembox
| Name = Theasinensin B
| ImageFile = Theasinensin B.svg
| Section1 = {{Chembox Identifiers
| CASNo = 89064-32-4
| PubChem = 467315
| ChEMBL = 159548
| ChemSpiderID = 410676
| StdInChI=1S/C37H30O18/c38-12-3-18(40)14-7-24(46)35(53-25(14)5-12)16-8-22(44)31(48)33(50)28(16)29-17(9-23(45)32(49)34(29)51)36-27(10-15-19(41)4-13(39)6-26(15)54-36)55-37(52)11-1-20(42)30(47)21(43)2-11/h1-6,8-9,24,27,35-36,38-51H,7,10H2/t24-,27-,35-,36-/m1/s1
| StdInChIKey = CTVAVEOYQKVFFY-DUSGSIEYSA-N
| SMILES = C1C(C(OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3C4=C(C(=C(C=C4C5C(CC6=C(C=C(C=C6O5)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O)O)O)O)O)O)O)O
}}
| Section2 = {{Chembox Properties
| C=37 | H=30 | O=18
}}
}}
Theasinensin B is polyphenol flavonoid from black tea (Thea sinensis).
See also
References
- {{Cite journal| doi = 10.1248/cpb.31.3906| volume = 31| issue = 11| pages = 3906–3914| last1 = Nonaka| first1 = Genichiro| last2 = Kawahara| first2 = Osamu| last3 = Nishioka| first3 = Itsuo| title = Tannins and Related Compounds. XV. A New Class of Dimeric Flavan-3-ol Gallates, Theasinensins A and B, and Proanthocyanidin Gallates from Green Tea Leaf. (1)| journal = Chemical and Pharmaceutical Bulletin| accessdate = 2018-11-26| date = 1983-11-25| url = https://www.jstage.jst.go.jp/article/cpb1958/31/11/31_11_3906/_article/-char/ja/| doi-access = free}}
{{organic-compound-stub}}