Thenalidine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447809040

| IUPAC_name = 1-Methyl-N-phenyl-N-(2-thienylmethyl)piperidin-4-amine

| image = Thenalidine.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 86-12-4

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 25957

| smiles = s1c(ccc1)CN(c2ccccc2)C3CCN(C)CC3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C17H22N2S/c1-18-11-9-16(10-12-18)19(14-17-8-5-13-20-17)15-6-3-2-4-7-15/h2-8,13,16H,9-12,14H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = KLOHYVOVXOUKQI-UHFFFAOYSA-N

| ATC_prefix = D04

| ATC_suffix = AA03

| ATC_supplemental = {{ATC|R06|AX03}}
{{ATC|R06|AX53}} (combinations)

| PubChem = 27901

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB04826

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6U94N2D00F

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07194

| C=17 | H=22 | N=2 | S=1

}}

Thenalidine is an antihistamine with anticholinergic properties used as an antipruritic drug.{{cite journal | vauthors = Getzler NA, Ereaux LP | title = Evaluation of thenalidine tratrate (sandostene) in dermatological disorders | journal = Canadian Medical Association Journal | volume = 80 | issue = 6 | pages = 445–8 | date = March 1959 | pmid = 13629433 | pmc = 1830689 }} It was withdrawn from the US, Canadian, and UK markets in 1963 due to a risk of neutropenia.{{cite web | url = http://www.drugbank.ca/drugs/DB04826 | title = Thenalidine | publisher = DrugBank}}