Thiamphenicol
{{short description|Antibiotic}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 470606287
| IUPAC_name = 2,2-dichloro-N-
| image = Thiamphenicol.svg
| width = 214
| image2 = Thiamphenicol_sf.gif
| tradename = Urfamycin
| Drugs.com = {{drugs.com|international|thiamphenicol}}
| pregnancy_category =
| legal_status =
| routes_of_administration = IV, IM, oral
| bioavailability = | metabolism = hepatic
| elimination_half-life = 5.0 hours
| excretion = renal
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 15318-45-3
| ATC_prefix = J01
| ATC_suffix = BA02
| ATC_supplemental = {{ATCvet|J51|BA02}}
| PubChem = 27200
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB08621
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 25315
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = FLQ7571NPM
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01407
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 32215
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1236282
| C=12 | H=15 | Cl=2 | N=1 | O=5 | S=1
| smiles = ClC(Cl)C(=O)N[C@@H]([C@H](O)c1ccc(cc1)S(=O)(=O)C)CO
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OTVAEFIXJLOWRX-NXEZZACHSA-N
| melting_point = 164.3
| melting_high = 166.3
}}
Thiamphenicol (also known as thiophenicol and dextrosulphenidol) is an antibiotic.{{cite book|title= Antimicrobial Agents|chapter=Chapter 33 : Phenicols| vauthors = Fisch A, Bryskier A | veditors = Bryskier A |year=2005|publisher=American Society for Microbiology|doi=10.1128/9781555815929.ch33}} It is the methyl-sulfonyl analogue of chloramphenicol and has a similar spectrum of activity, but is 2.5 to 5 times as potent. Like chloramphenicol, it is insoluble in water, but highly soluble in lipids. It is used in many countries as a veterinary antibiotic, but is available in China, Morocco and Italy for use in humans. Its main advantage over chloramphenicol is that it has never been associated with aplastic anaemia.
Thiamphenicol is also widely used in Brazil, particularly for the treatment of sexually transmitted infections such as pelvic inflammatory disease.{{cite book | vauthors = Fuchs FD |chapter=Tetraciclinas e cloranfenicol | veditors = Fuchs FD, Wannmacher L, Ferreira MB |title=Farmacologia clínica: fundamentos da terapêutica racional |language=Portuguese |edition=3rd |publisher=Guanabara Koogan |location=Rio de Janeiro |year=2004 |pages=[https://archive.org/details/textbookofmedica00guyt/page/375 375] |isbn=0-7216-5944-6 |chapter-url-access=registration |chapter-url=https://archive.org/details/textbookofmedica00guyt/page/375 }}
Unlike chloramphenicol, thiamphenicol is not readily metabolized in cattle, poultry, sheep, or humans, but is predominantly excreted unchanged. In pigs and rats the drug is excreted both as parent drug and as thiamphenicol glucuronate.{{cite book | vauthors = Francis PG | chapter = Thiamphenicol | title = Residues of some veterinary drugs in animals and foods. FAO Food and Nutrition Paper (41/9) | chapter-url = http://www.fao.org/docrep/W4601E/w4601e0d.htm | location = Rome | publisher = Food and Agriculture Organization (FAO), World Health Organization (WHO) | date = 1997 | isbn = 92-5-103972-0 }}
Thiamphenicol can be administered as a part of a complex molecule, Thiamphenicol glycinate acetylcysteine.{{cite journal | vauthors = Serra A, Schito GC, Nicoletti G, Fadda G | title = A therapeutic approach in the treatment of infections of the upper airways: thiamphenicol glycinate acetylcysteinate in sequential treatment (systemic-inhalatory route) | journal = International Journal of Immunopathology and Pharmacology | volume = 20 | issue = 3 | pages = 607–617 | date = 2007 | pmid = 17880774 | doi = 10.1177/039463200702000319 }}
References
{{Reflist}}
Further reading
{{refbegin}}
- {{cite journal | vauthors = Marchese A, Debbia EA, Tonoli E, Gualco L, Schito AM | title = In vitro activity of thiamphenicol against multiresistant Streptococcus pneumoniae, Haemophilus influenzae and Staphylococcus aureus in Italy | journal = Journal of Chemotherapy | volume = 14 | issue = 6 | pages = 554–561 | date = December 2002 | pmid = 12583545 | doi = 10.1179/joc.2002.14.6.554 | s2cid = 22843552 }}
- {{cite journal | vauthors = Raymond J, Boutros N, Bergeret M | title = [Role of thiamphenicol in the treatment of community-acquired lung infections] | journal = Médecine Tropicale | volume = 64 | issue = 1 | pages = 33–38 | year = 2004 | pmid = 15224555 }}
{{refend}}
{{Amphenicols}}
Category:Beta-Hydroxyamphetamines