Thiamylal
{{Short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 470606310
| IUPAC_name = 5-(Pentan-2-yl)-5-(prop-2-en-1-yl)-2-sulfanylidenedihydropyrimidine-4,6(1H,5H)-dione
| image = ThiamylalSVG.svg
| image_class = skin-invert-image
| width = 100
| tradename =
| Drugs.com = {{drugs.com|international|thiamylal}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_BR = B1
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}
| legal_CA = Schedule IV
| legal_UK =
| legal_US = Schedule III
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism = Hepatic
| elimination_half-life = 14.3 h (cats)
| excretion =
| IUPHAR_ligand = 7305
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 77-27-0
| ATCvet = yes
| ATC_prefix = N01
| ATC_suffix = AF90
| PubChem = 3032285
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01154
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2297298
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 01T23W89FR
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D06106
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9536
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 440
| C=12 | H=18 | N=2 | O=2 | S=1
| smiles = O=C1NC(=S)NC(=O)C1(C(C)CCC)C\C=C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H18N2O2S/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XLOMZPUITCYLMJ-UHFFFAOYSA-N
| synonyms = Thiamylal, Thioseconal, Surital
}}
Thiamylal (Surital) is a barbiturate derivative invented in the 1950s. It has sedative, anticonvulsant, and hypnotic effects, and is used as a strong but short acting sedative. Thiamylal is still in current use, primarily for induction in surgical anaesthesia{{cite journal | vauthors = Hsieh MY, Hung GY, Hsieh YL, Chang CY, Hwang B | title = Deep sedation with methohexital or thiamylal with midazolam for invasive procedures in children with acute lymphoblastic leukemia | journal = Acta Paediatrica Taiwanica = Taiwan Er Ke Yi Xue Hui Za Zhi | volume = 46 | issue = 5 | pages = 294–300 | date = 2005 | pmid = 16640004 }} or as an anticonvulsant to counteract side effects from other anaesthetics.{{cite journal | vauthors = Tsai CJ, Wang HM, Lu IC, Tai CF, Wang LF, Soo LY, Lu DV | title = Seizure after local anesthesia for nasopharyngeal angiofibroma | journal = The Kaohsiung Journal of Medical Sciences | volume = 23 | issue = 2 | pages = 97–100 | date = February 2007 | pmid = 17339174 | doi = 10.1016/S1607-551X(09)70383-3 | doi-access = free }} It is the thiobarbiturate analogue of secobarbital.
References
{{Sedatives}}
{{GABAA receptor positive modulators}}
{{Xenobiotic-sensing receptor modulators}}
{{General anesthetics}}
Category:GABAA receptor positive allosteric modulators
{{sedative-stub}}