Thioperamide
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 470607399
| IUPAC_name = N-Cyclohexyl-4-(1H-imidazol-4-yl)piperidine-1-carbothioamide
| image = Thioperamide.svg
| tradename =
| pregnancy_category =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 106243-16-7
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = II4319BWUI
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3035905
| IUPHAR_ligand = 1267
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2300031
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 260374
| C=15 | H=24 | N=4 | S=1
| smiles = S=C(NC1CCCCC1)N3CCC(c2cnc[nH]2)CC3
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H24N4S/c20-15(18-13-4-2-1-3-5-13)19-8-6-12(7-9-19)14-10-16-11-17-14/h10-13H,1-9H2,(H,16,17)(H,18,20)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QKDDJDBFONZGBW-UHFFFAOYSA-N
}}
Thioperamide is a potent HRH4 antagonist and selective HRH3 antagonist capable of crossing the blood–brain barrier.{{cite web |url= https://www.guidetopharmacology.org/GRAC/LigandDisplayForward?tab=biology&ligandId=1267 |work = IUPHAR/BPS Guide to Pharmacology | title = Thioperamide }}
It was used by Jean-Charles Schwartz in his early experiments regarding the H3 receptor.{{cite journal | vauthors = Schwartz JC | title = The histamine H3 receptor: from discovery to clinical trials with pitolisant | journal = British Journal of Pharmacology | volume = 163 | issue = 4 | pages = 713–21 | date = June 2011 | pmid = 21615387 | pmc = 3111674 | doi = 10.1111/j.1476-5381.2011.01286.x }} Thioperamide was found to be an antagonist of histamine autoreceptors, which negatively regulate the release of histamine. The drug enhances the activity of histaminergic neurons by blocking autoreceptors, leading to greater release of histamine.
Its action on H3 receptors is thought to promote wakefulness and improve memory consolidation.