Thiorphan
{{short description|Chemical compound}}
{{cs1 config|name-list-style=vanc}}
{{further|Racecadotril}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470608964
| IUPAC_name = (±)-2-[(2-benzyl-3-sulfanyl-propanoyl)amino]acetic acid
| image = Thiorphan2DCSD.svg
| width = 200px
| chirality = Racemic mixture
| drug_name =
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 76721-89-6
| ATC_prefix = none
| ATC_suffix =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LJJKNPQAGWVLDQ-UHFFFAOYSA-N
| PubChem = 3132
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB08626
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = B79L7B5X3Z
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3020
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 10247
| KEGG = C01619
| C=12 | H=15 | N=1 | O=3 | S=1
| smiles = C1=CC=C(C=C1)CC(CS)C(=O)NCC(=O)O
}}
Thiorphan is the active metabolite of the antidiarrheal racecadotril (acetorphan).{{cite journal | vauthors = Spillantini MG, Geppetti P, Fanciullacci M, Michelacci S, Lecomte JM, Sicuteri F | title = In vivo 'enkephalinase' inhibition by acetorphan in human plasma and CSF | journal = European Journal of Pharmacology | volume = 125 | issue = 1 | pages = 147–50 |date=June 1986 | pmid = 3015640 | doi = 10.1016/0014-2999(86)90094-4}} It prevents the degradation of endogenous enkephalins by acting as an enkephalinase inhibitor.{{cite journal | journal = Drugs | pmid = 10804038 | volume=59 | issue=4 | title = Racecadotril |date=April 2000 | pages=829–35; discussion 836–7 |vauthors=Matheson AJ, Noble S | doi=10.2165/00003495-200059040-00010| s2cid = 245710392 }}
References
{{Reflist}}
{{Antidiarrheals}}
{{Opioidergics}}
Category:Enkephalinase inhibitors
Category:Amino acid derivatives
{{gastrointestinal-drug-stub}}