Thonzylamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470609231

| IUPAC_name = N-(4-methoxybenzyl)-N',N'-dimethyl-N-pyrimidin-2-ylethane-1,2-diamine

| image = Thonzylamine.svg

| tradename =

| Drugs.com = {{drugs.com|international|thonzylamine}}

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 91-85-0

| CAS_supplemental = {{CAS|63-56-9}}

| ATC_prefix = D04

| ATC_suffix = AA01

| ATC_supplemental = {{ATC|R01|AC06}} {{ATC|R06|AC06}}

| PubChem = 5457

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5258

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1623738

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = R79646H5Z8

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08587

| synonyms = Neohetramine

| C=16 | H=22 | N=4 | O=1

| smiles = n1cccnc1N(CCN(C)C)Cc2ccc(OC)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H22N4O/c1-19(2)11-12-20(16-17-9-4-10-18-16)13-14-5-7-15(21-3)8-6-14/h4-10H,11-13H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GULNIHOSWFYMRN-UHFFFAOYSA-N

}}

Thonzylamine (or neohetramine){{cite journal | vauthors = Arminio JJ, Sweet CC | title = The prophylaxis and treatment of the common cold with neohetramine (thonzylamine hydrochloride) | journal = Industrial Medicine & Surgery | volume = 18 | issue = 12 | pages = 509–11 | date = December 1949 | pmid = 15393969 }} is an antihistamine and anticholinergic used as an antipruritic.