Thozalinone
{{Short description|Chemical compound}}
{{cs1 config|name-list-style=vanc}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470609358
| IUPAC_name = (RS)-2-(Dimethylamino)-5-phenyl-1,3-oxazol-4(5H)-one
| image = Thozalinone.svg
| image_class = skin-invert-image
| alt = Skeletal formula
| image2 = Thozalinone molecule spacefill.png
| image_class2 = bg-transparent
| alt2 = Space-filling model
| width2 = 155
| width = 200px
| chirality = Racemic mixture
| tradename =
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 655-05-0
| ATC_prefix = none
| ATC_suffix =
| PubChem = 12602
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 12082
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 68X5932947
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D06115
| ChEMBL = 2105457
| synonyms = Tozalinone, Thozalinon
| C=11 | H=12 | N=2 | O=2
| smiles = O=C2\N=C(/OC2c1ccccc1)N(C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H12N2O2/c1-13(2)11-12-10(14)9(15-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JJSHYECKYLDYAR-UHFFFAOYSA-N
}}
Thozalinone (USAN) (brand name Stimsen; former developmental code name CL-39808) is a psychostimulant that has been used as an antidepressant in Europe.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA435|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=435–}}{{cite journal | vauthors = Greenblatt EN, Osterberg AC | title = Some pharmacologic properties of thozalinone, a new excitant | journal = Toxicology and Applied Pharmacology | volume = 7 | issue = 4 | pages = 566–78 | date = July 1965 | pmid = 4378772 | doi = 10.1016/0041-008X(65)90042-6 }}{{cite book | title = Dictionary of organic compounds | publisher = Chapman & Hall | location = London | year = 1996 | isbn = 0-412-54090-8 | url = https://books.google.com/books?id=C3Uo1co4Wv0C&q=thozalinone&pg=PA2539 | access-date = 2021-05-31 | archive-date = 2021-05-31 | archive-url = https://web.archive.org/web/20210531152758/https://books.google.com/books?id=C3Uo1co4Wv0C&q=thozalinone&pg=PA2539 | url-status = live }}{{cite book | title = Merck index on CD-ROM: Windows | publisher = Chapman & Hall EPD | location = London | year = 1998 | isbn = 0-412-82910-X }}{{cite journal | vauthors = Gallant DM, Bishop MP, Scrignar CB, Hornsby L, Moore B, Inturrisi BB | title = A double-blind study of thozalinone (C1 39,808) in depressed outpatients | journal = Current Therapeutic Research, Clinical and Experimental | volume = 8 | issue = 12 | pages = 621–2 | date = December 1966 | pmid = 4962734 }} It has also been trialed as an anorectic.{{cite journal | vauthors = Leite AC, Liepen LL, Costa VP | title = [Clinical trial of Stimsem Thozalinone in the treatment of obese patients] | language = pt | journal = Revista Brasileira de Medicina | volume = 28 | issue = 9 | pages = 475–8 | date = September 1971 | pmid = 5139648 }} Thozalinone is described as a "dopaminergic stimulant",{{cite journal | vauthors = Yen-Koo HC, Balazs T | title = Detection of dopaminergic supersensitivity induced by neuroleptic drugs in mice | journal = Drug and Chemical Toxicology | volume = 3 | issue = 2 | pages = 237–47 | year = 1980 | pmid = 6112126 | doi = 10.3109/01480548009108286 }} and likely acts via inducing the release of dopamine and to a minimal extent norepinephrine; similar to analogue pemoline, it is reportedly devoid of abuse potential unlike other dopaminergic psychostimulants.{{cite journal | vauthors = Yen-Koo HC, Davis DA, Balazs T | title = Inhibition of dopaminergic agonist-induced gnawing behavior by neuroleptic drugs in mice | journal = Drug and Chemical Toxicology | volume = 8 | issue = 6 | pages = 495–502 | year = 1985 | pmid = 2868876 | doi = 10.3109/01480548509041072 }}
Synthesis
[[File:Thozalinone synthesis.svg|class=skin-invert-image|center|500px|thumb|Synthesis:
{{cite journal | vauthors = Howell CF, Quinones NQ, Hardy Jr RA | title = 2-Amino-2-oxazolin-4-ones. I. Synthesis. | journal = The Journal of Organic Chemistry | date = May 1962 | volume = 27 | issue = 5 | pages = 1679–1685 | doi = 10.1021/jo01052a047 }}{{cite journal | vauthors = Lindberg UH, Pedersen J | title = Compounds related to pemoline. 2-amino-5-aryl-4-oxo-2-oxazolines | journal = Acta Pharmaceutica Suecica | volume = 5 | issue = 1 | pages = 15–22 | date = February 1968 | pmid = 4386169 | doi = | url = }}]]
Sodium hydride is used as a strong base to abstract the alcohol proton in ethyl mandelate [774-40-3] (1); addition of the oxyanion to dimethylcyanamide [1467-79-4] gives the intermediate (2). Intramolecular cyclization then occurs giving Thozalinone (3).
=Notes=
- In treatment of Parkinsonism: W. D. Gray, C. E. Edward, {{US patent|3665075}} (1972 to Am. Cyanamid).
- Pharmacological studies:{{cite journal | vauthors= Bernstein BM, Latimer CN | journal=Psychopharmacologia | title=Behavioral facilitation: The interaction of imipramine and desipramine with amphetamine, alpha-pipradrol, methylphenidate, and thozalinone | volume=12 | issue=4 | pages=338–345 | date= 1968 | doi=10.1007/BF00401412| pmid=4385109 | s2cid=31096140 }}
See also
References
{{Reflist|2}}
{{Stimulants}}
{{Antidepressants}}
{{Anorectics}}
{{Monoamine releasing agents}}
Category:Dimethylamino compounds