Thymopentin

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 470609802

| IUPAC_name = (3S)-3-{{bracket|[(2S)-6-amino-2-{{bracket|[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino}}hexanoyl]amino}}-4-{{bracket|[(2S)-1-{{bracket|[(2S)-1-hydroxy-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino}}-3-methyl-1-oxobutan-2-yl]amino}}-4-oxobutanoic acid

| image = Thymopentin.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 69558-55-0

| ATC_prefix = L03

| ATC_suffix = AX09

| PubChem = 451417

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 397640

| NIAID_ChemDB = 000127

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = O3Y80ZF13F

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D06117

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 156025

| C=30 | H=49 | N=9 | O=9

| smiles = O=C(N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc1ccc(O)cc1)C(C)C)CC(=O)O)CCCCN)[C@@H](N)CCC/N=C(\N)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C30H49N9O9/c1-16(2)24(28(46)38-22(29(47)48)14-17-8-10-18(40)11-9-17)39-27(45)21(15-23(41)42)37-26(44)20(7-3-4-12-31)36-25(43)19(32)6-5-13-35-30(33)34/h8-11,16,19-22,24,40H,3-7,12-15,31-32H2,1-2H3,(H,36,43)(H,37,44)(H,38,46)(H,39,45)(H,41,42)(H,47,48)(H4,33,34,35)/t19-,20-,21-,22-,24-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = PSWFFKRAVBDQEG-YGQNSOCVSA-N

| synonyms = L-arginyl-L-lysyl-L-α-aspartyl-L-valyl-L-tyrosine

}}

Thymopentin is an immunostimulant. As such, it has been used in several clinical studies in the early years of the AIDS pandemic (from 1983 to 1985). Thymopentin helped to improve immunological condition in several patients for a brief time under specific treatments.{{cite journal |vauthors=Mascart-Lemone F, Huygen K, Clumeck N, Brenez D, Bolla K, Duchateau J |title=Stimulation of cellular function by thymopentin (TP-5) in three AIDS patients |journal=Lancet |volume=322 |issue=8352 |pages=735–736 |year=1983 |pmid=6193382 |doi=10.1016/S0140-6736(83)92271-7 |s2cid=519367 |url=http://www.lancet.com/journals/lancet/article/PIIS0140-6736(83)92271-7/fulltext|url-access=subscription }}{{cite journal |vauthors=Clumeck N, Van de Perre P, Mascart-Lemone F, Cran S, Bolla K, Duchateau J |title=Preliminary results on clinical and immunological effects of thymopentin in AIDS |journal=Int J Clin Pharmacol Res |volume=4 |issue= 6|pages=459–463 |year=1984 |pmid=6398315 }}{{cite journal |vauthors=Clumeck N, Cran S, Van de Perre P, Mascart-Lemone F, Duchateau J, Bolla K |title=Thymopentin treatment in AIDS and pre-AIDS patients |journal=Surv Immunol Res |volume=4 |issue=1 |pages=supp1 58–62 |year=1985 |pmid=3898293 |url=https://link.springer.com/article/10.1007%2FBF02919057 |doi=10.1007/BF02919057|s2cid=36555170 |url-access=subscription }}

It interacts with T cells.{{cite journal |vauthors=Liu Z, Zheng X, Wang J, Wang E |editor1-last=Egli |editor1-first=Martin |title=Molecular analysis of thymopentin binding to HLA-DR molecules |journal=PLOS ONE |volume=2 |issue=12 |pages=e1348 |year=2007 |pmid=18159232 |pmc=2137936 |doi=10.1371/journal.pone.0001348 |bibcode=2007PLoSO...2.1348L |doi-access=free }} {{open access}}

It is a thymic polypeptide.{{cite journal |vauthors=Peng Y, Chen Z, Yu W, etal |title=Effects of thymic polypeptides on the thymopoiesis of mouse embryonic stem cells |journal=Cell Biology International |volume= 32|issue= 10|pages= 1265–71|date=July 2008 |pmid=18692582 |doi=10.1016/j.cellbi.2008.07.011 |s2cid=24144448 }}

References

{{Reflist}}

{{Immunostimulants}}

Category:Peptides

Category:Immunostimulants

{{antineoplastic-drug-stub}}