Tiamulin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 376122925

| IUPAC_name = [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.0^1,8]tetradecanyl] 2-[2-(diethylamino)ethylsulfanyl]acetate

| image = Tiamulin skeletal.svg

| width =

| tradename = Dynamutilin, others

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Veterinary use only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 55297-95-5

| ATCvet = yes

| ATC_prefix = J01

| ATC_suffix = XQ01

| ATC_supplemental =

| PubChem = 656958

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = E38WZ4U54R

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 498466

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 44137

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 571196

| chemical_formula =

| C=28 | H=47 | N=1 | O=4 | S=1

| smiles = CCN(CC)CCSCC(=O)O[C@@H]1C[C@@]([C@H]([C@@H]([C@@]23CC[C@H]([C@@]1([C@@H]2C(=O)CC3)C)C)C)O)(C)C=C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C28H47NO4S/c1-8-26(6)17-22(33-23(31)18-34-16-15-29(9-2)10-3)27(7)19(4)11-13-28(20(5)25(26)32)14-12-21(30)24(27)28/h8,19-20,22,24-25,32H,1,9-18H2,2-7H3/t19-,20+,22-,24+,25+,26-,27+,28+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UURAUHCOJAIIRQ-QGLSALSOSA-N

}}

Tiamulin (previously thiamutilin) is a pleuromutilin antibiotic drug that is used in veterinary medicine particularly for pigs and poultry.{{cite web | url = http://www.bioagrimix.com/haccp/html/tiamulin.htm | work = HACCP | title = Tiamulin in Veterinary Medicine | archive-url = https://web.archive.org/web/20090610080725/http://www.bioagrimix.com/haccp/html/tiamulin.htm | archive-date=2009-06-10 }}{{cite journal | vauthors = Long KS, Hansen LH, Jakobsen L, Vester B | title = Interaction of pleuromutilin derivatives with the ribosomal peptidyl transferase center | journal = Antimicrobial Agents and Chemotherapy | volume = 50 | issue = 4 | pages = 1458–62 | date = April 2006 | pmid = 16569865 | pmc = 1426994 | doi = 10.1128/AAC.50.4.1458-1462.2006 | url = }}

Tiamulin is a diterpene antimicrobial with a pleuromutilin chemical structure similar to that of valnemulin.{{cite web | url = http://www.emea.europa.eu/pdfs/vet/mrls/074700en.pdf | work = EMEA | title = Tiamulin Summary Report }}