Tiazesim

{{Short description|Discontinued antidepressant medication}}

{{Drugbox

| IUPAC_name = 5-[2-(dimethylamino)ethyl]-2-phenyl-2,3-dihydro-1,5-benzothiazepin-4(5H)-one

| image = Thiazesim.svg

| image_class = skin-invert-image

| width = 175px

| tradename = Altinil

| legal_status = Rx-only

| routes_of_administration = By mouth

| CAS_number = 5845-26-1

| CAS_supplemental =
3122-01-8 (hydrochloride)

| ATC_prefix = None

| PubChem = 22107

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 20775

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 44G76ZB85O

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02699

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 2111123

| synonyms = Thiazesim; Thiazenone; SQ-10496

| C=19 | H=22 | N=2 | O=1 | S=1

| SMILES = CN(C)CCN1C(=O)CC(SC2=CC=CC=C21)C3=CC=CC=C3

| StdInChI = 1S/C19H22N2OS/c1-20(2)12-13-21-16-10-6-7-11-17(16)23-18(14-19(21)22)15-8-4-3-5-9-15/h3-11,18H,12-14H2,1-2H3

| StdInChIKey = QJJXOEFWXSQISU-UHFFFAOYSA-N

}}

Tiazesim ({{abbrlink|INN|International Nonproprietary Name}}), or thiazesim ({{abbrlink|BAN|British Approved Name}}, {{abbrlink|USAN|United States Adopted Name}}), previously sold under the brand name Altinil, is a heterocyclic antidepressant related to the tricyclic antidepressants (TCAs) which, introduced in 1966 by Squibb Corporation (now Bristol-Myers Squibb), has since been discontinued and is no longer marketed.{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1973 | access-date = 29 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1973}}{{cite book | title = The United States patents quarterly | url = https://books.google.com/books?id=rcVKAQAAIAAJ | access-date = 1 May 2012 | oclc = 1768767 | year = 1969}}