Tinidazole

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 470610559

| image = Tinidazole.svg

| width = 160

| alt =

| image2 = Tinidazole ball-and-stick model from xtal 2020.png

| tradename = Fasigyn, Simplotan, Tindamax

| Drugs.com = {{drugs.com|monograph|tinidazole}}

| MedlinePlus = a604036

| DailyMedID = Tinidazole

| pregnancy_AU = B3

| routes_of_administration = By mouth{{cite web | title=Tinidazole | website=AdisInsight | date=2 October 2021 | url=https://adisinsight.springer.com/drugs/800024976 | access-date=26 February 2025}}

| ATC_prefix = J01

| ATC_suffix = XD02

| ATC_supplemental = {{ATC|G01|AF21}}, {{ATC|J01|RA11}}, {{ATC|J01|RA13}}, {{ATC|J01|RA18}}, {{ATC|P01|AB02}}, {{ATC|P01|AB53}}, {{ATCvet|P51|AA02}}

| legal_AU = S4

| legal_UK = POM

| legal_US = Rx-only

| protein_bound = 12%

| metabolism = Liver (CYP3A4)

| elimination_half-life = 12–14 hours

| excretion = Urine (20–25%), feces (12%)

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 19387-91-8

| PubChem = 5479

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00911

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5279

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 033KF7V46H

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D01426

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1220

| NIAID_ChemDB = 007940

| IUPAC_name = 1-(2-ethylsulfonylethyl)-2-methyl-5-nitro-imidazole

| C=8 | H=13 | N=3 | O=4 | S=1

| smiles = CCS(=O)(=O)CCN1C(=NC=C1[N+](=O)[O-])C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H13N3O4S/c1-3-16(14,15)5-4-10-7(2)9-6-8(10)11(12)13/h6H,3-5H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = HJLSLZFTEKNLFI-UHFFFAOYSA-N

}}

Tinidazole, sold under the brand name Tindamax among others, is a medication used against protozoan infections. It is widely known throughout Europe and the developing world as a treatment for a variety of anaerobic amoebic and bacterial infections. It was developed in 1972 and is a prominent member of the nitroimidazole antibiotic class.{{cite book | vauthors = Ebel K, Koehler H, Gamer AO, Jäckh R | chapter = Imidazole and Derivatives. | title = In Ullmann's Encyclopedia of Industrial Chemistry | date = 2002 | publisher = Wiley-VCH | doi = 10.1002/14356007.a13_661 | isbn = 3527306730 }}

It is on the World Health Organization's List of Essential Medicines.{{cite book | vauthors = ((World Health Organization)) | title = World Health Organization model list of essential medicines: 22nd list (2021) | year = 2021 | hdl = 10665/345533 | author-link = World Health Organization | publisher = World Health Organization | location = Geneva | id = WHO/MHP/HPS/EML/2021.02 | hdl-access=free }}

Medical uses

Tinidazole may be a therapeutic alternative in the setting of metronidazole intolerance. Tinidazole is used to treat Helicobacter pylori, Amoebic dysentery, Giardia and Trichomonas vaginalis.{{cite journal | vauthors = Edwards DI | title = Nitroimidazole drugs--action and resistance mechanisms. I. Mechanisms of action | journal = The Journal of Antimicrobial Chemotherapy | volume = 31 | issue = 1 | pages = 9–20 | date = January 1993 | pmid = 8444678 | doi = 10.1093/jac/31.1.9 }}

Side effects

Drinking alcohol while taking tinidazole causes an unpleasant disulfiram-like reaction, which includes nausea, vomiting, headache, increased blood pressure, flushing, and shortness of breath.{{medcn|date=December 2022}}

Pharmacology

=Pharmacokinetics=

Elimination half-life is 13.2 ± 1.4 hours. Plasma half-life is 12 to 14 hours.{{medcn|date=December 2022}}

History

Tinidazole was approved for treatment of bacterial vaginosis in the United States in 2007.

See also

References

{{Reflist}}

{{Other antibacterials}}

{{Gynecological anti-infectives and antiseptics}}

{{Agents against amoebiasis and other protozoal diseases}}

{{Excavata antiparasitics}}

{{Agents against amoebozoa}}

{{Portal bar | Medicine}}

{{Authority control}}

Category:Antiprotozoal agents

Category:Disulfiram-like drugs

Category:Nitroimidazole antibiotics

Category:Sulfones

Category:World Health Organization essential medicines