Tolnaftate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470611568

| IUPAC_name = O-2-Naphthyl methyl(3-methylphenyl)thiocarbamate

| image = Tolnaftate.svg

| tradename = Tinactin

| Drugs.com = {{drugs.com|monograph|tolnaftate}}

| MedlinePlus = a682617

| pregnancy_category =

| legal_status = OTC

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 2398-96-1

| ATC_prefix = D01

| ATC_suffix = AE18

| PubChem = 5510

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00525

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5309

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 06KB629TKV

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00381

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 9620

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 83668

| synonyms = 2-Naphthyl N-methyl-N-(3-tolyl)thionocarbamate{{cite web|title=International Non-Proprietary Names for Pharmaceutical Preparations. Recommended International Non-Proprietary names (Rec. I.N.N.): List 6|url=https://www.who.int/medicines/publications/druginformation/innlists/RL06.pdf|publisher=World Health Organization|access-date=12 November 2016}}

| C=19 | H=17 | N=1 | O=1 | S=1

| smiles = S=C(Oc2ccc1c(cccc1)c2)N(c3cc(ccc3)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H17NOS/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18/h3-13H,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FUSNMLFNXJSCDI-UHFFFAOYSA-N

| melting_point = 110

| melting_high = 111.5

}}

Tolnaftate (INN), sold under the brand name TAGRID, among others, is a synthetic thiocarbamate used as an anti-fungal agent that may be sold without medical prescription in most jurisdictions. It is supplied as a cream, powder, spray, liquid, and liquid aerosol. Tolnaftate is used to treat fungal conditions such as jock itch, athlete's foot and ringworm.{{Cite web|title=Tolnaftate|url=https://medlineplus.gov/druginfo/meds/a682617.html|website=MedlinePlus,gov}}