Tolpiprazole
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 1-(3-Methylphenyl)-4-[2-(5-methyl-1H-pyrazol-3-yl)ethyl]piperazine
| image = Tolpiprazole.png
| tradename =
| pregnancy_category =
| legal_status = Uncontrolled
| routes_of_administration = Oral
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 20326-13-0
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3084338
| ChemSpiderID = 2341419
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8XP74P4HO3
| C=17 | H=24 | N=4
| smiles = Cc3cccc(N2CCN(CCc1cc(C)[nH]n1)CC2)c3
}}
Tolpiprazole (INN, BAN) (developmental code name H-4170) is an anxiolytic drug of the phenylpiperazine group that was never marketed.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1217|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=1217–}}
See also
References
{{Reflist|2}}
{{Serotonergics}}
{{Piperazines}}