Tolvaptan phosphate

{{Short description|Drug for cardiac edema}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Tolvaptan phosphate.svg

| alt =

| caption =

| pronounce =

| tradename = Samtasu

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| synonyms = Tolvaptan sodium phosphate; OPC-61815

| CAS_number = 942619-74-1

| PubChem = 146035877

| DrugBank =

| KEGG = D11659

| ChemSpiderID = 17342600

| UNII = Y4P6WS9QVF

| ChEBI =

| ChEMBL =

| IUPAC_name = [(5R)-7-Chloro-1-[2-methyl-4-[(2-methylbenzoyl)amino]benzoyl]-2,3,4,5-tetrahydro-1-benzazepin-5-yl] dihydrogen phosphate

| C = 26 | H = 26 | Cl = 1 | N = 2 | O = 6 | P = 1

| SMILES = CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)N3CCCC(C4=C3C=CC(=C4)Cl)OP(=O)(O)O)C

| Jmol =

| StdInChI = InChI=1S/C26H26ClN2O6P/c1-16-6-3-4-7-20(16)25(30)28-19-10-11-21(17(2)14-19)26(31)29-13-5-8-24(35-36(32,33)34)22-15-18(27)9-12-23(22)29/h3-4,6-7,9-12,14-15,24H,5,8,13H2,1-2H3,(H,28,30)(H2,32,33,34)/t24-/m1/s1

| StdInChI_comment =

| StdInChIKey = XTCFGVRVASPRTK-XMMPIXPASA-N

}}

Tolvaptan phosphate is a drug used for the treatment of cardiac edema. It is a prodrug of tolvaptan,{{cite journal | vauthors = Kinugawa K, Nakata E, Hirano T, Kim S | title = Tolerability of the Intravenously Administered Tolvaptan Prodrug, OPC-61815, in Patients With Congestive Heart Failure Who Have Difficulty With, or Are Incapable of, Oral Intake (TRITON-HF) - A Phase III, Multicenter, Open-Label Trial | journal = Circulation Journal | date = March 2022 | volume = 86 | issue = 7 | pages = 1068–1078 | pmid = 35264514 | doi = 10.1253/circj.CJ-21-0926 | s2cid = 247362001 | doi-access = free }}{{cite journal | vauthors = Sato N, Uno S, Yamasaki Y, Hirano T, Kim S | title = Pharmacokinetics, Pharmacodynamics, Efficacy, and Safety of OPC-61815, a Prodrug of Tolvaptan for Intravenous Administration, in Patients With Congestive Heart Failure - A Phase II, Multicenter, Double-Blind, Randomized, Active-Controlled Trial | journal = Circulation Journal | volume = 86 | issue = 4 | pages = 699–708 | date = March 2022 | pmid = 34511586 | doi = 10.1253/circj.CJ-21-0430 | s2cid = 237493273 | collaboration = OPC-61815 Investigators | doi-access = free }} formulated as the salt tolvaptan sodium phosphate, for intravenous administration. Tolvaptan phosphate is converted into the active drug tolvaptan in the human body following administration.

It was developed by Otsuka Pharmaceutical Co. and was approved for use in Japan in 2022.{{Cite press release | publisher = Otsuka Pharmaceutical Co., Ltd. | url = https://www.otsuka.co.jp/en/company/newsreleases/2022/20220328_1.html | title = Otsuka Obtains Approval in Japan for SAMTASU® for I.V. Infusion, a V2 -Receptor Antagonist for the Treatment of Cardiac Edema | date = March 28, 2022 | access-date = June 11, 2022 | archive-date = November 13, 2022 | archive-url = https://web.archive.org/web/20221113131145/https://www.otsuka.co.jp/en/company/newsreleases/2022/20220328_1.html | url-status = live }}