Trans-2-Phenyl-1-cyclohexanol

{{DISPLAYTITLE:trans-2-Phenyl-1-cyclohexanol}}

{{chembox

| Name = trans-2-Phenyl-1-cyclohexanol

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470612367

| ImageFile=(1S,2R)-2-phenylcyclohexanol-2D-skeletal.png

| ImageCaption = (1S,2R)-2-Phenylcyclohexanol

| IUPACName=

| OtherNames=trans-2-Phenylcyclohexanol

|Section1={{Chembox Identifiers

| index1_label = (±)

| index2_label = (−)-(1R,2S)

| index3_label = (+)-(1S,2R)

| ChemSpiderID3_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID3 = 8074632

| InChI3 = 1/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+/m1/s1

| InChIKey3 = AAIBYZBZXNWTPP-NEPJUHHUBI

| InChI4_Ref = {{stdinchicite|correct|chemspider}}

| InChI4 = 1S/C12H16O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-13H,4-5,8-9H2/t11-,12+/m1/s1

| InChIKey4_Ref = {{stdinchicite|correct|chemspider}}

| InChIKey4 = AAIBYZBZXNWTPP-NEPJUHHUSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo1 = 2362-61-0

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo2 = 98919-68-7

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo3 = 34281-92-0

| CASNo3_Ref = {{cascite|correct|CAS}}

| UNII1 = 452WZ637M8

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII2 = O5411L8484

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII3 = D2U0RW1Y61

| UNII3_Ref = {{fdacite|correct|FDA}}

| PubChem3=9898975

| SMILES3 = O[C@@H]2[C@@H](c1ccccc1)CCCC2

}}

|Section2={{Chembox Properties

| C=12 | H=16 | O=1

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

trans-2-Phenyl-1-cyclohexanol is an organic compound. The two enantiomers of this compound are used in organic chemistry as chiral auxiliaries.

Preparation

The enantioselective synthesis was accomplished by J. K. Whitesell by adding Pseudomonas fluorescens lipase to racemic trans-2-phenylcyclohexyl chloroacetate.{{cite journal | author = J. K. Whitesell, H. H. Chen and R. M. Lawrence | title = trans-2-Phenylcyclohexanol. A powerful and readily available chiral auxiliary | year = 1985 | journal = J. Org. Chem. | volume = 50 | issue = 23 | pages = 4663–4664 | doi = 10.1021/jo00223a055}}{{OrgSynth | collvol = 8 | collvolpages = 516 | year = 1993 | prep = cv8p0516 | title = Lipase-Catalyzed Kinetic Resolution of Alcohols via Chloroacetate Esters: (−)-(1R,2S)-Trans-2-Phenylcyclohexanol And (+)-(1S,2R)-Trans-2-Phenylcyclohexanol | author = A. Schwartz, P. Madan, J. K. Whitesell, and R. M. Lawrence}} This enzyme is able to hydrolyze the ester bond of the (−)-enantiomer but not the (+)-enantiomer. The (−)-cyclohexanol and the (+)-ester are separated by fractional crystallization and the isolated (+)-ester hydrolyzed to the (+)-cyclohexanol in a separate step.

The enantiomers have also been prepared by the Sharpless asymmetric dihydroxylation of 1-phenylcyclohexene to the diol followed by the selective reduction of the 1-hydroxyl group by Raney nickel.{{OrgSynth | title = Sharpless bishydroxylation procedure to trans-2-phenyl-1-cyclohexanol | collvol = 10 | collvolpages = 603 | year = 2004 | prep = V79P0093 | author = Javier Gonzalez, Christine Aurigemma, and Larry Truesdale}}

Image:Trans-2-phenyl-1-hexanol enantiomers.gif]]{{clear-left}}

References

{{reflist}}

{{DEFAULTSORT:Phenyl-1-hexanol, trans-2-}}

Category:Secondary alcohols

Category:Phenyl compounds