Trans-Resveratrol-3-O-glucuronide

{{DISPLAYTITLE:trans-Resveratrol-3-O-glucuronide}}

{{chembox

| Verifiedfields =

| verifiedrevid =

| Name = trans-Resveratrol-3-O-glucuronide

| ImageFile = Resveratrol 3-O-D-glucuronide.svg

| ImageSize =

| IUPACName = 3-Hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethen-1-yl]phenyl β-D-glucopyranosiduronic acid

| SystematicName = (2S,3S,4S,5R,6S)-3,4,5-Trihydroxy-6-{3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethen-1-yl]phenoxy}oxane-2-carboxylic acid

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 387372-17-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LNK7Z424CK

| EINECS =

| ChEMBL_Ref =

| ChEMBL =

| PubChem = 5273285

| ChemSpiderID = 4437760

| SMILES = O=C(O)[C@H]3O[C@@H](Oc2cc(O)cc(\C=C\c1ccc(O)cc1)c2)[C@H](O)[C@@H](O)[C@@H]3O

| InChI = 1/C20H20O9/c21-12-5-3-10(4-6-12)1-2-11-7-13(22)9-14(8-11)28-20-17(25)15(23)16(24)18(29-20)19(26)27/h1-9,15-18,20-25H,(H,26,27)/b2-1+/t15-,16-,17+,18-,20+/m0/s1

| InChIKey = QWSAYEBSTMCFKY-OTPOQTMVBZ

| StdInChI = 1S/C20H20O9/c21-12-5-3-10(4-6-12)1-2-11-7-13(22)9-14(8-11)28-20-17(25)15(23)16(24)18(29-20)19(26)27/h1-9,15-18,20-25H,(H,26,27)/b2-1+/t15-,16-,17+,18-,20+/m0/s1

| StdInChIKey = QWSAYEBSTMCFKY-OTPOQTMVSA-N

| RTECS =

| MeSHName =

| ChEBI_Ref =

| ChEBI =

| KEGG_Ref =

| KEGG =

}}

|Section2={{Chembox Properties

| C=20 | H=20 | O=9

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb =

}}

|Section7={{Chembox Hazards

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL =

}}

}}

trans-Resveratrol-3-O-glucuronide is a metabolite of resveratrol{{Cite journal | last1 = Urpi-Sarda | first1 = M. | last2 = Zamora-Ros | first2 = R. | last3 = Lamuela-Raventos | first3 = R. | last4 = Cherubini | first4 = A. | last5 = Jauregui | first5 = O. | last6 = De La Torre | first6 = R. | last7 = Covas | first7 = M. I. | last8 = Estruch | first8 = R. | last9 = Jaeger | first9 = W. | doi = 10.1373/clinchem.2006.071936 | last10 = Andres-Lacueva | first10 = C. | title = HPLC-Tandem Mass Spectrometric Method to Characterize Resveratrol Metabolism in Humans | journal = Clinical Chemistry | volume = 53 | issue = 2 | pages = 292–299 | year = 2006 | pmid = 17170057| doi-access = free }} and trans-resveratrol-3-O-glucoside (piceid).{{Cite journal | last1 = Zhou | first1 = M. | last2 = Chen | first2 = X. | last3 = Zhong | first3 = D. | title = Simultaneous determination of trans-resveratrol-3-O-glucoside and its two metabolites in rat plasma using liquid chromatography with ultraviolet detection | doi = 10.1016/j.jchromb.2007.04.025 | journal = Journal of Chromatography B | volume = 854 | pages = 219–223 | year = 2007 | issue = 1–2 | pmid = 17500049}}{{Cite journal | last1 = Mikulski | first1 = D. | last2 = Molski | first2 = M. | doi = 10.1016/j.ejmech.2010.02.016 | title = Quantitative structure–antioxidant activity relationship of trans-resveratrol oligomers, trans-4,4′-dihydroxystilbene dimer, trans-resveratrol-3-O-glucuronide, glucosides: Trans-piceid, cis-piceid, trans-astringin and trans-resveratrol-4′-O-β-D-glucopyranoside | journal = European Journal of Medicinal Chemistry | volume = 45 | issue = 6 | pages = 2366–2380 | year = 2010 | pmid = 20199826 }}