Triadimefon

{{Chembox

| ImageFile = Triadimefon.svg

| ImageSize =

| IUPACName = 1-(4-Chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one

| OtherNames = Triadimeform

|Section1={{Chembox Identifiers

| CASNo = 43121-43-3

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1HW039CJF0

| PubChem = 39385

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 9665

| ChemSpiderID = 36029

| SMILES = CC(C)(C)C(=O)C(N1C=NC=N1)OC2=CC=C(C=C2)Cl

| InChI = 1/C14H16ClN3O2/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h4-9,13H,1-3H3

| InChIKey = WURBVZBTWMNKQT-UHFFFAOYAV

| StdInChI = 1S/C14H16ClN3O2/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h4-9,13H,1-3H3

| StdInChIKey = WURBVZBTWMNKQT-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=14 | H=16 | Cl=1 | N=3 | O=2

| Appearance =

| Density = 1.22 g/cm³{{GESTIS|ZVG= 33280}}

| MeltingPtC = 82

| MeltingPt_ref =

| BoilingPt = decomposes

| Solubility =64 mg/L (20 °C)

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

| LD50 = 363 mg/kg (oral, rat)
> 5000 mg/kg (dermal, rat)

}}

}}

Triadimefon is a fungicide used in agriculture to control various fungal diseases. As a seed treatment, it is used on barley, corn, cotton, oats, rye, sorghum, and wheat.{{cite web | url = http://www.epa.gov/oppsrrd1/REDs/factsheets/triadimefon_triadimenol_fs.htm | title = Triadimefon Reregistration Eligibility Decision (RED) and Triadimenol Tolerance Reassessment and Risk Management Decision (TRED) Fact Sheet | publisher = Environmental Protection Agency}} In fruit it is used on pineapple and banana. Non-food uses include pine seedlings, Christmas trees, turf, ornamental plants, and landscaping.