Triamcinolone hexacetonide

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 2-[(4aS,4bR,5S,6aS,6bS,9aR,10aS,10bS)-4b-Fluoro-5-hydroxy-4a,6a,8,8-tetramethyl-2-oxo-2,4a,4b,5,6,6a,9a,10,10a,10b,11,12-dodecahydro-6bH-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-6b-yl]-2-oxoethyl 3,3-dimethylbutanoate

| image = Triamcinolone hexacetonide.svg

| image_class = skin-invert-image

| width =

| alt =

| tradename = Aristospan

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration =

| legal_AU =

| legal_CA = Rx-only

| legal_CA_comment = {{cite web | title=Arthritis | website=Health Canada | date=8 May 2018 | url=https://www.canada.ca/en/services/health/drug-health-products/drug-medical-device-highlights-2017/approved-drugs/arthritis.html | access-date=13 April 2024}}{{cite web | title=Regulatory Decision Summary for Triamcinolone Hexacetonide Injectable Suspension | website=Drug and Health Products Portal | date=12 December 2017 | url=https://dhpp.hpfb-dgpsa.ca/review-documents/resource/RDS00306 | access-date=13 April 2024}}

| legal_UK =

| legal_US =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 5611-51-8

| CAS_supplemental =

| class = Corticosteroid; Glucocorticoid

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 21826

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 20516

| UNII = I7GT1U99Y9

| KEGG =

| ChEBI = 9670

| ChEMBL = 1200878

| C=30 | H=41 | F=1 | O=7

| SMILES = C[C@]12C[C@@H]([C@]3([C@H]([C@@H]1C[C@@H]4[C@]2(OC(O4)(C)C)C(=O)COC(=O)CC(C)(C)C)CCC5=CC(=O)C=C[C@@]53C)F)O

| StdInChI_Ref =

| StdInChI = 1S/C30H41FO7/c1-25(2,3)15-24(35)36-16-22(34)30-23(37-26(4,5)38-30)13-20-19-9-8-17-12-18(32)10-11-27(17,6)29(19,31)21(33)14-28(20,30)7/h10-12,19-21,23,33H,8-9,13-16H2,1-7H3/t19-,20-,21-,23+,27-,28-,29-,30+/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = TZIZWYVVGLXXFV-FLRHRWPCSA-N

| synonyms = Triamcinolone acetonide 21-tebutate; Triamcinolone acetonide 21-(tert-butylacetate); 9α-Fluoro-11β,16α,17α,21-tetrahydroxypregna-1,4-diene-3,20-dione cyclic 16,17-acetal with acetone, 21-(3,3-dimethylbutyrate); 9α-Fluoro-11β-hydroxy-16α,17α-((1-methylethylidene)bis(oxy))pregna-1,4-diene-3,20-dione 21-(3,3-dimethylbutyrate)

}}

Triamcinolone hexacetonide (brand name Aristospan; also known as triamcinolone acetonide 21-tebutate) is a synthetic glucocorticoid corticosteroid.{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1228|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=1228–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=RA1-PA1657|year=2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=1657}}{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA280|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=280–}}

It is on the World Health Organization's List of Essential Medicines.{{cite book | vauthors = ((World Health Organization)) | title = The selection and use of essential medicines 2023: web annex A: World Health Organization model list of essential medicines: 23rd list (2023) | year = 2023 | hdl = 10665/371090 | author-link = World Health Organization | publisher = World Health Organization | location = Geneva | id = WHO/MHP/HPS/EML/2023.02 | hdl-access=free }}