Triethylenemelamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 376279379

| IUPAC_name = 2,4,6-Tris(aziridin-1-yl)-1,3,5-triazine

| image = Triethylenemelamine.png

| width = 150

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 51-18-3

| ATC_prefix = None

| ATC_suffix =

| PubChem = 5799

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = F7IY6HZG9D

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C07642

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 502384

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 5594

| C=9 | H=12 | N=6

| smiles = C1CN1c2nc(nc(n2)N3CC3)N4CC4

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI=1S/C9H12N6/c1-2-13(1)7-10-8(14-3-4-14)12-9(11-7)15-5-6-15/h1-6H2

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = IUCJMVBFZDHPDX-UHFFFAOYSA-N

}}

Triethylenemelamine (abbreviated TEM, also called Tretamine) is a drug used in chemotherapy.{{cite journal | vauthors = Wong JR, Morton LM, Tucker MA, Abramson DH, Seddon JM, Sampson JN, Kleinerman RA | title = Risk of subsequent malignant neoplasms in long-term hereditary retinoblastoma survivors after chemotherapy and radiotherapy | journal = Journal of Clinical Oncology | volume = 32 | issue = 29 | pages = 3284–3290 | date = October 2014 | pmid = 25185089 | pmc = 4178525 | doi = 10.1200/JCO.2013.54.7844 }}

It can cause chromatid aberrations in cell models.{{cite journal | vauthors = Luippold HE, Gooch PC, Brewen JG | title = The production of chromosome aberrations in various mammalian cells by triethylenemelamine | journal = Genetics | volume = 88 | issue = 2 | pages = 317–326 | date = February 1978 | pmid = 565312 | pmc = 1213803 | doi = 10.1093/genetics/88.2.317 }}