Trimellitic acid

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid =

| ImageFile = Trimellitic_acid.png

| ImageSize = 160

| ImageName =

| PIN = Benzene-1,2,4-tricarboxylic acid

| OtherNames = 1,2,4-Benzenetricarboxylic acid; 4-Carboxyphthalic acid; 1,2,4-Tricarboxybenzene

|Section1={{Chembox Identifiers

| CASNo = 528-44-9

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 10708

| PubChem1 =

| PubChem1_Comment =

| PubChem2 =

| PubChem2_Comment =

| ChemSpiderID = 10258

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID1 =

| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID1_Comment =

| ChemSpiderID2 =

| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID2_Comment =

| UNII = 7NVY29MQ5F

| UNII_Ref = {{fdacite|correct|FDA}}

| EINECS =

| KEGG =

| KEGG_Ref = {{keggcite|changed|kegg}}

| MeSHName =

| ChEBI =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEMBL =

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL1 =

| ChEMBL1_Ref = {{ebicite|correct|EBI}}

| Beilstein =

| SMILES = c1cc(c(cc1C(=O)O)C(=O)O)C(=O)O

| StdInChI =

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = YIWUKEYIRIRTPP-UHFFFAOYSA-N

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

}}

|Section2={{Chembox Properties

| C=9 | H=6 | O=6

| Appearance = White solid

| Density =

| MeltingPtC = 221-222

| MeltingPt_ref = {{cite journal |last1=Fishwick |first1=Brian |title=233. The analysis of mixtures of benzene-carboxylic acids by partition chromatography |journal=Journal of the Chemical Society (Resumed) |date=1957 |pages=1196 |doi=10.1039/JR9570001196}}

| BoilingPtC =

| LogP = 2.721

| Solubility = 21 g/L (0.1M) at 25 °C{{citation needed |date=July 2023 |reason=removed blacklisted drugfuture reference}}

| VaporPressure =

| RefractIndex =

}}

|Section3={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section4={{Chembox Hazards

| GHSPictograms =

| GHSSignalWord =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

}}

|Section5={{Chembox Related

| OtherFunction_label =

| OtherFunction =

| OtherCompounds = }}

}}

Trimellitic acid (benzene-1,2,4-tricarboxylic acid) is a chemical compound with the molecular formula C₆H₃(СООН)₃. Like the other isomers of benzenetricarboxylic acid, trimellitic acid is a colorless solid. It is prepared by oxidation of 1,2,4-trimethylbenzene.{{cite book|last1=Park|first1=Chang-Man|title=Kirk-Othmer Encyclopedia of Chemical Technology|last2=Sheehan|first2=Richard J.|year=2000|doi=10.1002/0471238961.1608200816011811.a01|chapter=Phthalic Acids and Other Benzenepolycarboxylic Acids|isbn=0471238961}}