Trinitroanisole

{{Chembox

| Watchedfields = changed

| verifiedrevid = 444962668

| ImageFile = 2,4,6-Trinitroanisole.svg

| ImageSize = 150px

| ImageAlt =

| PIN = 2-Methoxy-1,3,5-trinitrobenzene

| OtherNames = 2,4,6-Trinitroanisol; picric acid methyl esther; trisol; trinol; trinitroanisole

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo =606-35-9

| PubChem = 11817

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 11324

| EINECS = 620-419-8

| UNII = N042W5PE52

| SMILES = COc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-]

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = InChI=1S/C7H5N3O7/c1-17-7-5(9(13)14)2-4(8(11)12)3-6(7)10(15)16/h2-3H,1H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FMXDVBRYDYFVGS-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C =7|H=5|N=3|O=7

| Appearance = yellow, "leaf-like" crystals

| Density = 1.61 g/cm3

| MeltingPtC = 68

| BoilingPt = explodes

| Solubility = insoluble in water, soluble in diethyl ether and hot ethanol}}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS01}}{{GHS07}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|201|302|312|332|411}}

| PPhrases = {{P-phrases|210|230|240|250|261|264|270|271|273|280|301+312|302+352|304+312|304+340|312|322|330|363|370+380|372|373|391|401|501}}

| MainHazards = explosive

| FlashPt =

| AutoignitionPt =

}}

}}

Trinitroanisole is a chemical compound that exists as pale yellow crystals with a melting point of 68 °C. It is highly toxic. It is an explosive with a detonation velocity of 7200 meters per second.Wasag-Chemie, Essen. "Explosivstoffe". 1961, p. 164. The compound's primary hazard is a blast of an instantaneous explosion, not flying projectiles or fragments.{{Cite web |last=PubChem |title=2,4,6-Trinitroanisole |url=https://pubchem.ncbi.nlm.nih.gov/compound/11817 |access-date=2023-11-13 |website=pubchem.ncbi.nlm.nih.gov |language=en}}

Synthesis

Trinitroanisole was first prepared in 1849 by the French chemist Auguste Cahours by reacting p-anisic acid (French: acide anisique) with a mixture of sulfuric acid and fuming nitric acid.{{cite journal |last1=Cahours |first1=Auguste |title=Researches relatives à l'action du mélange d'acide sulfurique et d'acide nitrique fumants sur les matières organiques |journal=Annales de Chimie et de Physique |date=1849 |series=3rd series |volume=25 |pages=5–44 |url=https://babel.hathitrust.org/cgi/pt?id=hvd.hx3dy4&view=1up&seq=11 |trans-title=Investigations concerning the action of a mixture of sulfuric acid and fuming nitric acid on organic materials |language=French}} See especially pp. 21-30.{{cite book |last1=Fedoroff |first1=Basil T. |display-authors=etal |title=Encyclopedia of Explosives and Related Items |date=1960 |publisher=Picatinny Arsenal |location=Dover, N.J. |volume=1 |pages=A450–A453 |url=https://archive.org/stream/Ullmans/01%20Ullmans-U-S-ARMY-Encyclopedia-of-Explosives-and-Related-Items-Vol-01#page/n557/mode/2up/}}

Trinitroanisole can be prepared by the reaction of 2,4-dinitrochlorobenzene with methanol in the presence of sodium hydroxide followed by the nitration of the resulting product. Alternatively, it can be prepared directly by the reaction of picryl chloride with methanol in the presence of sodium hydroxide.

Use

Historically, trinitroanisole was used as a military explosive (e.g., Japanese {{abbr|Type 91|Japanese Imperial year 2591 stands for 1931 AD}} or German Trinol), having the advantage of being made from readily obtainable raw materials such as phenol. However, due to its toxicity and tendency to form picric acid and dangerous picrate salts, its use has largely been abandoned.

See also

Notes