Trinitroethylorthocarbonate

{{Chembox

| Reference =

| Name = Trinitroethylorthocarbonate

| IUPACName = 2,2,2-Trinitroethyl orthocarbonate

| PIN = 1,1,1-Trinitro-2-[tris(2,2,2-trinitroethoxy)methoxy]ethane

| OtherNames = {{Unbulleted list | TNEOC }}

| ImageFile = Trinitroethylorthocarbonate.png

| ImageSize =

| ImageAlt =

| ImageName =

| Section1 = {{Chembox Identifiers

| 3DMet =

| Abbreviations =

| Beilstein =

| CASNo = 14548-58-4

| CASNo_Comment =

| ChEBI =

| PubChem = 139779

| ChemSpiderID = 123272

| SMILES = C(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])OC(OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])(OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-]

| StdInChI = 1S/C9H8N12O28/c22-10(23)5(11(24)25,12(26)27)1-46-9(47-2-6(13(28)29,14(30)31)15(32)33,48-3-7(16(34)35,17(36)37)18(38)39)49-4-8(19(40)41,20(42)43)21(44)45/h1-4H2

| StdInChIKey = JPTHXHQVODRICI-UHFFFAOYSA-N

| EINECS =

| EC_number =

| EC_number_Comment =

| Gmelin =

| KEGG =

| MeSHName =

| RTECS =

| UNNumber =

}}

| Section2 = {{Chembox Properties

| AtmosphericOHRateConstant =

| Appearance = Colorless crystals

| BoilingPt =

| BoilingPtC =

| BoilingPt_ref =

| BoilingPt_notes =

| Density =

| Formula = {{chem2|C(OCH2C(NO2)3)4}}

| C=9|H=8|N=12|O=28

| HenryConstant =

| LogP =

| MeltingPt =

| MeltingPtC = 161

| MeltingPt_ref =

| MeltingPt_notes =

| pKa =

| pKb =

| Solubility =

| SolubleOther =

| Solvent =

| VaporPressure =

}}

| Section3 = {{Chembox Structure

| Coordination =

| CrystalStruct =

| MolShape =

}}

| Section4 = {{Chembox Thermochemistry

| DeltaGf =

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity =

}}

| Section5 = {{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

| Section7 = {{Chembox Hazards

| AutoignitionPt =

| ExploLimits =

| ExternalMSDS =

| FlashPt =

| LD50 =

| LC50 =

| MainHazards =

| NFPA-F =

| NFPA-H =

| NFPA-R =

| NFPA-S =

| PEL =

| REL =

| HPhrases =

| PPhrases =

| GHS_ref =

}}

| Section9 = {{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Trinitroethylorthocarbonate, also known as TNEOC, is an organic compound with the chemical formula {{chem2|C(OCH2C(NO2)3)4}}. It is an oxidizer with excellent chemical stability.{{Citation needed|reason=exellent chemical stability is a subjective term and any statement of stability needs to have contextual information given the statement later in the page about the highly explosive nature of this compound|date=May 2017}} Its explosion point is 238 °C, and it begins to be decomposed at 200 °C. Its explosion heat is 5.797 J/g and specific volume is 694 L/kg.{{cite book|last1=Liu|first1=Jiping|title=Liquid Explosives|date=2015|publisher=Springer|isbn=9783662458471|pages=5, 6, 8, 136, 309|url=https://books.google.com/books?id=NGYiBgAAQBAJ&pg=PA8|accessdate=26 March 2016}} Its structure is closely related to that of trinitroethylorthoformate (TNEOF). Both are highly explosive and very shock-sensitive, and may be dissolved in nitroalkanes to reduce their shock-sensitivity.