Trinitroethylorthoformate

{{Chembox

| Reference =

| Name = Trinitroethylorthoformate

| PIN = 2-[Bis(2,2,2-trinitroethoxy)methoxy]-1,1,1-trinitroethane

| OtherNames = {{Unbulleted list|TNEOF}}

| ImageFile = Trinitroethylorthoformate.svg

| ImageSize =

| ImageAlt =

| ImageName =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| ImageName1 =

| ImageFile2 =

| ImageSize2 =

| ImageAlt2 =

| ImageName2 =

| ImageFile3 =

| ImageSize3 =

| ImageAlt3 =

| ImageName3 =

| ImageFileL1 =

| ImageSizeL1 =

| ImageAltL1 =

| ImageNameL1 =

| ImageFileR1 =

| ImageSizeR1 =

| ImageAltR1 =

| ImageNameR1 =

| ImageFileL2 =

| ImageSizeL2 =

| ImageAltL2 =

| ImageNameL2 =

| ImageFileR2 =

| ImageSizeR2 =

| ImageAltR2 =

| ImageNameR2 =

| Section1 = {{Chembox Identifiers

| 3DMet =

| Abbreviations =

| Beilstein =

| CASNo = 14548-59-5

| CASNo_Comment =

| ChEBI =

| EINECS =

| EC_number =

| EC_number_Comment =

| Gmelin =

| KEGG =

| MeSHName =

| RTECS =

| PubChem = 139780

| ChemSpiderID = 123273

| SMILES = C(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])OC(OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])OCC([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-]

| StdInChI = 1S/C7H7N9O21/c17-8(18)5(9(19)20,10(21)22)1-35-4(36-2-6(11(23)24,12(25)26)13(27)28)37-3-7(14(29)30,15(31)32)16(33)34/h4H,1-3H2

| StdInChIKey = NWWHXKXUBVOXEX-UHFFFAOYSA-N

| UNNumber =

}}

| Section2 = {{Chembox Properties

| AtmosphericOHRateConstant =

| Appearance = Colorless crystals

| BoilingPt =

| BoilingPtC =

| BoilingPt_ref =

| BoilingPt_notes =

| Density =

| Formula = C₇H₇N₉O₂₁

| HenryConstant =

| LogP =

| MolarMass = 553.174

| MeltingPt =

| MeltingPtC = 128

| MeltingPt_ref =

| MeltingPt_notes =

| pKa =

| pKb =

| Solubility =

| SolubleOther =

| Solvent =

| VaporPressure =

}}

| Section3 = {{Chembox Structure

| Coordination =

| CrystalStruct =

| MolShape =

}}

| Section4 = {{Chembox Thermochemistry

| DeltaGf =

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity =

}}

| Section5 = {{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

| Section6 = {{Chembox Pharmacology

| ATCvet =

| ATCCode_prefix =

| ATCCode_suffix =

| ATC_Supplemental =

| AdminRoutes =

| Bioavail =

| Excretion =

| HalfLife =

| Metabolism =

| legal_status =

| legal_AU =

| legal_AU_comment =

| legal_CA =

| legal_CA_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_US =

| legal_US_comment =

| legal_UK =

| legal_UK_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| pregnancy_category =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_US_comment =

| ProteinBound =

| Dependence_liability =

| Addiction_liability =

}}

| Section7 = {{Chembox Hazards

| AutoignitionPt =

| ExploLimits =

| ExternalMSDS =

| FlashPt =

| LD50 =

| LC50 =

| MainHazards =

| NFPA-F =

| NFPA-H =

| NFPA-R =

| NFPA-S =

| PEL =

| REL =

| HPhrases =

| PPhrases =

| GHS_ref =

}}

| Section9 = {{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

{{one source|date=May 2017}}Trinitroethylorthoformate also known as TNEOF is an explosive with excellent chemical stability. It does not have hygroscopicity, does not dissolve in water, and does not react with acids. It decomposes in aqueous sodium hydroxide solution to release formaldehyde odor. The explosion point of TNEOF is 229 °C, though it begins to decompose at 190 °C. Its explosion heat is 6.3076 J/g and specific volume is 682 L/kg.{{cite book|last1=Liu|first1=Jiping|title=Liquid Explosives|date=2015|publisher=Springer|isbn=9783662458471|pages=5, 6, 8, 136, 309|url=https://books.google.com/books?id=NGYiBgAAQBAJ&pg=PA8|accessdate=26 March 2016}} Its structure is closely related to that of trinitroethylorthocarbonate (TNEOC). Both are highly explosive and very shock-sensitive, and may be dissolved in nitroalkanes to reduce their shock-sensitivity.