Triphenyltin hydroxide

{{Chembox

| Verifiedfields = changed

| verifiedrevid = 470617074

| ImageFile = Ph3SnOH.png

| ImageSize = 170

| ImageAlt = Skeletal formula of triphenyltin hydroxide

| ImageFile1 = Triphenyltin-hydroxide-3D-spacefill.png

| ImageSize1 = 190px

| ImageAlt1 = Space-filling model of the triphenyltin hydroxide molecule

| PIN = Triphenylstannanol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 76-87-9

| Beilstein = 4139186

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID=21106510

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 30473

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 506538

| EINECS = 200-990-6

| Gmelin = 7194

| KEGG = C18729

| PubChem = 9907219

| PubChem_Comment =

| RTECS = WH8575000

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = KKL46V5313

| UNNumber = 2786 2588

| InChI = 1/3C6H5.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2;/q;;;;+1/p-1/rC18H16OSn/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H

| InChIKey = BFWMWWXRWVJXSE-OLMCWIPIAE

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/3C6H5.H2O.Sn/c3*1-2-4-6-5-3-1;;/h3*1-5H;1H2;/q;;;;+1/p-1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = BFWMWWXRWVJXSE-UHFFFAOYSA-M

| SMILES = O[Sn](c1ccccc1)(c2ccccc2)c3ccccc3

}}

|Section2={{Chembox Properties

| Formula = {{chem2|Sn(C6H5)3OH}}

| C=18 | H=16 | O=1 | Sn=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| GHSPictograms = {{GHS05}}{{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|301|311|315|318|330|335|351|361|372|410}}

| PPhrases = {{P-phrases|201|202|260|261|264|270|271|273|280|281|284|301+310|302+352|304+340|305+351+338|308+313|310|312|314|320|321|322|330|332+313|361|362|363|391|403+233|405|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Triphenyltin hydroxide is an organotin compound with formula Sn(C₆H₅)₃OH. Triphenyltin hydroxide is used as a fungicide for potatoes, sugar beets, and pecans. It was first registered for use as a pesticide in the United States in 1971.{{cite web | publisher = U.S. EPA | title = R.E.D. Facts: Triphenyltin Hydroxide | url = http://www.epa.gov/oppsrrd1/REDs/factsheets/0099fact.pdf}}