Triphosphoric acid

{{Refimprove|date=December 2014}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 446484776

| ImageFile = Triphosphorsäure.svg

| ImageSize =

| ImageAlt =

| ImageFile1 = Tripolyphosphoric-acid-3D-vdW.png

| ImageSize1 =

| ImageAlt1 = Structure of triphosphoric acid

| IUPACName = Diphosphono hydrogenphosphate

| SystematicName = Triphosphoric acid
Tripolyphosphoric acid

| PIN =

| OtherNames = Diphosphonophosphoric acid
Phosphono trihydrogenpyrophosphate
Phosphonopyrophosphoric acid

| Section1 = {{Chembox Identifiers

| CASNo = 10380-08-2

| CASNo_Ref = {{cascite|correct|??}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NU43IAG5BC

| PubChem = 983

| EINECS = 233-840-3

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 958

| SMILES = OP(=O)(O)OP(=O)(O)OP(=O)(O)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/H5O10P3/c1-11(2,3)9-13(7,8)10-12(4,5)6/h(H,7,8)(H2,1,2,3)(H2,4,5,6)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UNXRWKVEANCORM-UHFFFAOYSA-N

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 39949

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C00404}}

| Section2 = {{Chembox Properties

| Formula = H₅P₃O₁₀

| MolarMass = 257.95 g/mol

| ConjugateBase = Triphosphate

| pKa = See body

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

| Section3 = {{Chembox Hazards

| MainHazards = Corrosive (C)

| FlashPt =

| AutoignitionPt = }}

}}

Triphosphoric acid (also tripolyphosphoric acid), with formula H₅P₃O₁₀, is a condensed form of phosphoric acid. In the family of phosphoric acids, it is the next polyphosphoric acid after pyrophosphoric acid, H₄P₂O₇, also called diphosphoric acid.

Compounds such as ATP (adenosine triphosphate) are esters of triphosphoric acid.

Triphosphoric acid has not been obtained in crystalline form. The equilibrium mixture with an overall composition corresponding to H₅P₃O₁₀ contains about 20% of triphosphoric acid. A solution of the pure species can be obtained by ion exchange of the sodium salt, sodium triphosphate, at 0 °C.{{cite book |last=Corbridge |first=D. |title=Studies in inorganic Chemistry vol. 20|publisher=Elsevier Science B.V. |date=1995 |pages=169–305 |chapter=Chapter 3: Phosphates |isbn=0-444-89307-5}}

Triphosporic acid is a pentaprotic acid, meaning that it can release five protons in basic enough conditions. Sources differ on the corresponding pK_a values:

• 1.0; 2.2; 2.3; 5.7; 8.5
• 1.0; 2.2; 2.3; 3.7; 8.5{{Holleman&Wiberg|page=729}}
• small; small; 2.30; 6.50; 9.24{{Citation needed|date=September 2021}}