Triptonide

{{distinguish|text = Triptolide, another derivative of Tripterygium wilfordii}}

{{Chembox

| ImageFile = Triptonide.png

| ImageSize =

| IUPACName = (1S,2S,4S,5S,7S,9S,11S,13S)-1-methyl-7-propan-2-yl-3,6,10,16-tetraoxaheptacyclo[11.7.0.02,4.02,9.05,7.09,11.014,18]icos-14(18)-ene-8,17-dione

| OtherNames = Triptonide; NSC 165677; 14-deoxy-14-oxo-triptolide

| Section1 = {{Chembox Identifiers

| CASNo = 38647-11-9

| ChEBI = 132267

| ChEMBL = 205190

| ChemSpiderID = 58875

| DrugBank =

| EINECS =

| EC_number =

| InChI = 1S/C20H22O6/c1-8(2)18-13(25-18)14-20(26-14)17(3)5-4-9-10(7-23-15(9)21)11(17)6-12-19(20,24-12)16(18)22/h8,11-14H,4-7H2,1-3H3/t11-,12-,13-,14-,17-,18-,19+,20+/m0/s1

| InChIKey = SWOVVKGLGOOUKI-ZHGGVEMFSA-N

| KEGG =

| MeSHName =

| PubChem = 65411

| SMILES = CC(C)[C@@]12[C@@H](O1)[C@H]3[C@@]4(O3)[C@]5(CCC6=C([C@@H]5C[C@H]7[C@]4(C2=O)O7)COC6=O)C

}}

| Section2 = {{Chembox Properties

| C=20 | H=22 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Triptonide is a chemical compound found in Tripterygium wilfordii,{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/65411|title=Triptonide|website=pubchem.ncbi.nlm.nih.gov}} a plant used in traditional Chinese medicine.{{Cite web|url=https://www.nccih.nih.gov/health/thunder-god-vine|title=Thunder God Vine|website=NCCIH}} A 2021 trial in mice and monkeys suggested that triptonide may offer a reversible male contraceptive.{{Cite web|url=https://scitechdaily.com/male-birth-control-pill-natural-compound-discovered-with-ideal-contraceptive-effects/|title=Male Birth Control Pill: Natural Compound Discovered With "Ideal" Contraceptive Effects|first=The Lundquist|last=Institute|date=April 1, 2022|website=SciTechDaily}}{{cite journal |last1=Chang |first1=Zongliang |last2=Qin |first2=Weibing |last3=Zheng |first3=Huili |last4=Schegg |first4=Kathleen |last5=Han |first5=Lu |last6=Liu |first6=Xiaohua |last7=Wang |first7=Yue |last8=Wang |first8=Zhuqing |last9=McSwiggin |first9=Hayden |last10=Peng |first10=Hongying |last11=Yuan |first11=Shuiqiao |last12=Wu |first12=Jiabao |last13=Wang |first13=Yongxia |last14=Zhu |first14=Shenghui |last15=Jiang |first15=Yanjia |last16=Nie |first16=Hua |last17=Tang |first17=Yuan |last18=Zhou |first18=Yu |last19=Hitchcock |first19=Michael J. M. |last20=Tang |first20=Yunge |last21=Yan |first21=Wei |title=Triptonide is a reversible non-hormonal male contraceptive agent in mice and non-human primates |journal=Nature Communications |date=December 2021 |volume=12 |issue=1 |pages=1253 |doi=10.1038/s41467-021-21517-5|pmid=33623031 |pmc=7902613 |bibcode=2021NatCo..12.1253C |doi-access=free }}