Tris-biphenyl triazine

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Chembox

| ImageFile = 2,4,6-tri((1,1'-biphenyl)-4-yl)-1,3,5-triazine 200.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 2,4,6-Tris(4-phenylphenyl)-1,3,5-triazine

| OtherNames = Tinosorb A2B

| Section1 = {{Chembox Identifiers

| CASNo = 31274-51-8

| PubChem = 11628027

| UNII = FQK9A410YB

| ChemSpiderID = 9802774

| EC_number = 479-950-7

| DTXSID = DTXSID30185197

| InChI = 1S/C39H27N3/c1-4-10-28(11-5-1)31-16-22-34(23-17-31)37-40-38(35-24-18-32(19-25-35)29-12-6-2-7-13-29)42-39(41-37)36-26-20-33(21-27-36)30-14-8-3-9-15-30/h1-27H

| InChIKey = CENPSTJGQOQKKW-UHFFFAOYSA-N

| SMILES = C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC(=N3)C4=CC=C(C=C4)C5=CC=CC=C5)C6=CC=C(C=C6)C7=CC=CC=C7

}}

| Section2 = {{Chembox Properties

| C=39 | H=27 | N=3

| Appearance = White solid

| Density =

| MeltingPt = 281.3 °C

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| GHS_ref={{cite web |title=Tris-biphenyl triazine |url= https://pubchem.ncbi.nlm.nih.gov/compound/11628027 | work = PubChem | publisher = U.S. National Library of Medicine |language=en}}

| GHSPictograms =

| GHSSignalWord =

| HPhrases = {{H-phrases|413}}

| PPhrases = {{P-phrases|273|501}}

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Tris-biphenyl triazine (INCI) is an organic compound used in sunscreens to absorb UVA and UVB radiation. It is marketed as Tinosorb A2B by BASF. Tris-biphenyl triazine is considered a broad-spectrum UV absorber, covering the UVA2 (320−340 nm) and UVB range (280−320 nm).{{Cite web | title = Opinion on 1,3,5-Triazine, 2,4,6-tris[1,1'-biphenyl]-4-yl- | date = December 2011 | work = Scientific Committee on Consumer Safety (SCCS) |url= https://ec.europa.eu/health/scientific_committees/consumer_safety/docs/sccs_o_070.pdf |access-date=31 July 2024 | publisher = Directorate D: Health Systems and Products; European Commission }}{{cite journal | vauthors = Couteau C, Paparis E, Chauvet C, Coiffard L | title = Tris-biphenyl triazine, a new ultraviolet filter studied in terms of photoprotective efficacy | journal = International Journal of Pharmaceutics | volume = 487 | issue = 1–2 | pages = 120–123 | date = June 2015 | pmid = 25843762 | doi = 10.1016/j.ijpharm.2015.03.077 }}{{cite journal | vauthors = Bernerd F, Passeron T, Castiel I, Marionnet C | title = The Damaging Effects of Long UVA (UVA1) Rays: A Major Challenge to Preserve Skin Health and Integrity | journal = International Journal of Molecular Sciences | volume = 23 | issue = 15 | page = 8243 | date = July 2022 | pmid = 35897826 | pmc = 9368482 | doi = 10.3390/ijms23158243 | doi-access = free }}{{Cite journal |last1=Naumov |first1=Sergej |last2=Herzog |first2=Bernd |last3=Abel |first3=Bernd |date=2023-09-01 |title=Spectra and photorelaxation of tris-biphenyl-triazine-type UV absorbers: from monomers to nanoparticles |journal=Photochemical & Photobiological Sciences |language=en |volume=22 |issue=9 |pages=2143–2151 |doi=10.1007/s43630-023-00436-y |pmid=37277672 |issn=1474-9092|doi-access=free |bibcode=2023PhPhS..22.2143N }}