Trithionate

{{Chembox

| ImageFile = Trithionate dianion.svg

| IUPACName = 2,2,4,4-tetraoxido-1,5-dioxy-2,3,4-trisulfy-[5]catenate(2−)

|Section1 = {{Chembox Identifiers

| CASNo = 15579-17-6

| PubChem = 491

| ChemSpiderID = 477

| ChEBI = 15987

| Gmelin = 142337

| KEGG = C01861

| 3DMet = B01514

| StdInChI=1S/H2O6S3/c1-8(2,3)7-9(4,5)6/h(H,1,2,3)(H,4,5,6)/p-2

| StdInChIKey = KRURGYOKPVLRHQ-UHFFFAOYSA-L

| SMILES = [O-][S+2]([O-])([O-])S[S+2]([O-])([O-])[O-]

}}

| Section2={{Chembox Properties

| O=6 | S=3

| Formula_Charge = −2

| ConjugateAcid = Trithionic acid

}}

}}

Trithionate is an oxyanion of sulfur with the chemical formula {{chem|S|3|O|6|2−}}. It is the conjugate base of trithionic acid.{{Greenwood&Earnshaw2nd}} Dilute sodium hydroxide hydrolyzes tetrasulfur tetranitride as follows, yielding sodium thiosulfate and sodium trithionate:{{Cite journal|last1=Roesky|first1=H. W.|last2=Glemser|first2=Oskar|last3=Hoff|first3=Alfred |date=1968-04-01|title=Zur Hydrolyse des Thiazylfluorids und Tetraschwefeltetranitrids und über die Reaktion von Natriumthiosulfat mit Salzsäure|journal=Chemische Berichte|volume=101|issue=4|pages=1215-1222|doi=10.1002/cber.19681010413}}

:2 {{chem|S|4|N|4}} + 6 NaOH + 9 {{chem|H|2|O}} → {{chem|Na|2|S|2|O|3}} + 2 {{chem|Na|2|S|3|O|6}} + 8 {{chem|NH|3}}

Certain sulfate-reducing bacteria have been known to use the compound in respiration.{{Cite journal|last1=Oltmann|first1=L. F.|last2=Stouthamer|first2=A. H.|author-link2=Ad Stouthamer |date=1975-10-27|title=Reduction of tetrathionate, trithionate and thiosulphate, and oxidation of sulphide in proteus mirabilis|journal=Archives of Microbiology|volume=105|issue=2|pages=135–142|issn=0302-8933|pmid=1106343|doi=10.1007/BF00447128|bibcode=1975ArMic.105..135O |s2cid=1615795}}