Tritoqualine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 7-amino-4,5,6-triethoxy-3-(4-methoxy-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl)-3H-isobenzofuran-1-one

| image = Tritoqualine Structural Formula V1.svg

| tradename =

| Drugs.com = {{drugs.com|international|tritoqualine}}

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 14504-73-5

| ATC_prefix = R06

| ATC_suffix = AX21

| PubChem = 72145

| ChemSpiderID = 65119

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F4MW5166YH

| C=26 | H=32 | N=2 | O=8

| smiles = CCOC1=C(C(=C(C2=C1C(OC2=O)C3C4=C(C5=C(C=C4CCN3C)OCO5)OC)N)OCC)OCC

}}

Tritoqualine, also known as hypostamine, is an inhibitor of the enzyme histidine decarboxylase and therefore an atypical antihistamine, used for the treatment of urticaria and allergic rhinitis{{cite journal | vauthors = Pradalier A, Hentschel V, Prouzeau S, Legallais D, Lefrancois G | title = Randomized, placebo controlled study of tritoqualine (hypostamine*) in the treatment of perennial allergic rhinitis. | journal = Revue Française d'Allergologie et d'Immunologie Clinique | date = April 2003 | volume = 43 | issue = 3 | pages = 175–9 | doi = 10.1016/S0335-7457(03)00047-9 }} with no known adverse effects.{{fact|date=December 2013}}