Tromantadine

{{Short description|Antiviral medicine used to treat herpes simplex virus}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470617884

| IUPAC_name = N-(1-adamantyl)-2-[2-(dimethylamino)ethoxy]acetamide

| image = Tromantadine.svg

| alt = Skeletal formula

| tradename = Viru-Merz

| Drugs.com = {{drugs.com|international|tromantadine}}

| pregnancy_category =

| legal_US = Not FDA-approved

| legal_status = OTC (RU)

| routes_of_administration = Topical (gel)

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 53783-83-8

| ATC_prefix = D06

| ATC_suffix = BB02

| ATC_supplemental = {{ATC|J05|AC03}}

| PubChem = 64377

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 57947

| NIAID_ChemDB = 007760

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = H191JFG8WA

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07199

| C=16 | H=28 | N=2 | O=2

| SMILES = O=C(NC13CC2CC(CC(C1)C2)C3)COCCN(C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H28N2O2/c1-18(2)3-4-20-11-15(19)17-16-8-12-5-13(9-16)7-14(6-12)10-16/h12-14H,3-11H2,1-2H3,(H,17,19)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = UXQDWARBDDDTKG-UHFFFAOYSA-N

}}

Tromantadine is an antiviral medicine used to treat herpes simplex virus. It is available in a topical gel under trade names Viru-Merz and Viru-Merz Serol. Its performance is similar to aciclovir.{{cite journal | vauthors = Ostheimer KE, Busch T, Görtelmeyer R, Hahn KD | title = Randomized double-blind trial of tromantadine versus aciclovir in recurrent herpes orofacialis | journal = Arzneimittel-Forschung | volume = 39 | issue = 9 | pages = 1152–1155 | date = September 1989 | pmid = 2686658 }}{{cite journal | vauthors = Diezel W, Michel G, Görtelmeyer R, Ostheimer KE | title = Efficacy of tromantadine and aciclovir in the topical treatment of recurrent herpes orofacialis. Comparison in a clinical trial | journal = Arzneimittel-Forschung | volume = 43 | issue = 4 | pages = 491–496 | date = April 1993 | pmid = 8494582 }}

Like rimantadine, amantadine, and adapromine, tromantadine is a derivative of adamantane.