Tropacocaine
{{Chembox
| ImageFile = Tropacocaine.svg
| ImageClass = skin-invert-image
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageName = Stereo Kekulé, skeletal formula of tropacocaine with some explicit hydrogens added
| SystematicName= 3-exo-8-Methyl-8-azabicyclo[3.2.1]octan-3-yl benzoate
| OtherNames = 3β-Benzoyloxytropane
Benzoylpseudotropine
Pseudotropine benzoate
Tropacaine
|Section1={{Chembox Identifiers
| CASNo = 537-26-8
| CASNo_Ref = {{cascite|correct|??}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1I92X32F6H
| PubChem = 10834
| PubChem1 = 44279436
| PubChem1_Comment = (1R)
| PubChem2 = 6942461
| PubChem2_Comment = (1R,5R)
| PubChem3 = 637578
| PubChem3_Comment = (1R,5S)
| PubChem4 = 6919033
| PubChem4_Comment = (1S,5S)
| ChemSpiderID = 10194103
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS = 208-662-4
| KEGG = C10848
| KEGG_Ref = {{keggcite|correct|kegg}}
| MeSHName = tropacocaine
| ChEMBL = 419588
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| 3DMet = B05721
| SMILES = CN3[C@H]1CC[C@@H]3C[C@H](C1)OC(=O)c2ccccc2
| StdInChI = 1S/C15H19NO2/c1-16-12-7-8-13(16)10-14(9-12)18-15(17)11-5-3-2-4-6-11/h2-6,12-14H,7-10H2,1H3/t12-,13+,14-
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XQJMXPAEFMWDOZ-BTTYYORXSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
}}
|Section2={{Chembox Properties
| C=15 | H=19 | N=1 | O=2
| LogP = 2.607
}}
}}
Tropacocaine (tropacaine, benzoylpseudotropine, pseudotropine benzoate, descarbomethoxycocaine) is a cocaine-related alkaloid{{Cite journal | doi = 10.1039/CT9099501020| title = CXVI.?Relation between chemical constitution and physiological action in the tropeines. Part II| journal = Journal of the Chemical Society, Transactions| volume = 95| pages = 1020–1032| year = 1909| last1 = Jowett | first1 = H. A. D. | last2 = Pyman | first2 = F. L. }} and a contaminant of street cocaine.{{cite journal
|vauthors=Meyer EM, Potter LT, De Vane CL, Irwin I, MacKay SL, Miller R, Ruttenber AJ
|title=Effects of benzoyltropine and tropacocaine on several cholinergic processes in the rat brain
|journal=The Journal of Pharmacology and Experimental Therapeutics
|volume=254
|issue=2
|pages=584–90
|date=August 1990
|pmid=1974643
|doi=
|url=https://pubmed.ncbi.nlm.nih.gov/1974643/
|accessdate=2021-01-14
}}