Troxacitabine

{{Short description|Chemical compound}}

{{one source|date=August 2014}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 470618288

| IUPAC_name = 4-amino-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2(1H)-one

| image = Troxacitabine.svg

| width = 200px

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 145918-75-8

| ATC_suffix =

| PubChem = 151173

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 399955

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 60KQZ0388Y

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 359164

| C=8 | H=11 | N=3 | O=4

| smiles = O=C1/N=C(/N)\C=C/N1[C@H]2O[C@H](OC2)CO

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H11N3O4/c9-5-1-2-11(8(13)10-5)6-4-14-7(3-12)15-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RXRGZNYSEHTMHC-BQBZGAKWSA-N

| synonyms =

}}

Troxacitabine (brand name Troxatyl) is a nucleoside analogue with anticancer activity. Its use is being studied in patients with refractory lymphoproliferative diseases.{{cite journal | vauthors = Vose JM, Panwalkar A, Belanger R, Coiffier B, Baccarani M, Gregory SA, Facon T, Fanin R, Caballero D, Ben-Yehuda D, Giles F | display-authors = 6 | title = A phase II multicenter study of troxacitabine in relapsed or refractory lymphoproliferative neoplasms or multiple myeloma | journal = Leukemia & Lymphoma | volume = 48 | issue = 1 | pages = 39–45 | date = January 2007 | pmid = 17325846 | doi = 10.1080/10428190600909578 | s2cid = 36220728 }}