Troxerutin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447983598

| IUPAC_name = 2-[3,4-bis(2-hydroxyethoxy)phenyl]-5-hydroxy-7-(2-hydroxyethoxy)-4-oxo-4H-chromen-3-yl 6-O-(6-deoxy-β-D-mannopyranosyl)-β-D-glucopyranoside

| image = Troxerutin.svg

| tradename =

| Drugs.com = {{drugs.com|international|troxerutin}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 7085-55-4

| ATC_prefix = C05

| ATC_suffix = CA04

| PubChem = 9896814

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 3182320

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| KEGG = D07180

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7Y4N11PXO8

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4589027

| C=33 | H=42 | O=19

| smiles = C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc3c(=O)c4c(cc(cc4oc3c5ccc(c(c5)OCCO)OCCO)OCCO)O)O)O)O)O)O)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C33H42O19/c1-14-23(38)26(41)28(43)32(49-14)48-13-21-24(39)27(42)29(44)33(51-21)52-31-25(40)22-17(37)11-16(45-7-4-34)12-20(22)50-30(31)15-2-3-18(46-8-5-35)19(10-15)47-9-6-36/h2-3,10-12,14,21,23-24,26-29,32-39,41-44H,4-9,13H2,1H3/t14-,21+,23-,24+,26+,27-,28+,29+,32+,33-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = IYVFNTXFRYQLRP-VVSTWUKXSA-N

| synonyms = Hydroxyethylrutoside (HER)
Pherarutin
Trihydroxyethylrutin
3',4',7-Tris[O-(2-hydroxyethyl)]rutin

}}

Troxerutin is a flavonol, a type of flavonoid, derived from rutin.{{cite journal | vauthors = Zhang ZF, Fan SH, Zheng YL, Lu J, Wu DM, Shan Q, Hu B | title = Troxerutin improves hepatic lipid homeostasis by restoring NAD(+)-depletion-mediated dysfunction of lipin 1 signaling in high-fat diet-treated mice | journal = Biochemical Pharmacology | volume = 91 | issue = 1 | pages = 74–86 | date = September 2014 | pmid = 25026599 | doi = 10.1016/j.bcp.2014.07.002 }} It is more accurately a hydroxyethylrutoside. It can be isolated from Sophora japonica, the Japanese pagoda tree.

It is used as a vasoprotective.{{cite journal | vauthors = Riccioni C, Sarcinella R, Izzo A, Palermo G, Liguori M | title = [Effectiveness of Troxerutin in association with Pycnogenol in the pharmacological treatment of venous insufficiency] | journal = Minerva Cardioangiologica | volume = 52 | issue = 1 | pages = 43–8 | date = February 2004 | pmid = 14765037 }}

Troxerutin has been shown in mice to reverse CNS insulin resistance and reduce reactive oxygen species induced by a high-cholesterol diet.{{cite journal | vauthors = Lu J, Wu DM, Zheng ZH, Zheng YL, Hu B, Zhang ZF | title = Troxerutin protects against high cholesterol-induced cognitive deficits in mice | journal = Brain | volume = 134 | issue = Pt 3 | pages = 783–97 | date = March 2011 | pmid = 21252113 | doi = 10.1093/brain/awq376 | doi-access = free }}