Truxene

{{Chembox

| Name = Truxene

| ImageFile1 = Truxeen.png

| ImageSize1 = 240

| ImageName1 = Structural formula of truxene

| PIN = 10,15-dihydro-5H-diindeno-[1,2-a:1',2'-c]fluorene

|Section1 = {{Chembox Identifiers

|CASNo = 548-35-6

|CASNo_Ref = {{cascite|correct|CAS}}

|PubChem = 68355

|ChemSpiderID = 61650

|ChemSpiderID_Ref =

|UNII =

|UNII_Ref =

|KEGG =

|KEGG_Ref =

|ChEBI =

|ChEBI_Ref =

|ChEMBL =

|ChEMBL_Ref =

|RTECS =

|SMILES = C1C2=CC=CC=C2C3=C4CC5=CC=CC=C5C4=C6CC7=CC=CC=C7C6=C31

|EINECS = 208-944-7

|InChI = InChI=1S/C27H18/c1-4-10-19-16(7-1)13-22-25(19)23-14-17-8-3-6-12-21(17)27(23)24-15-18-9-2-5-11-20(18)26(22)24/h1-12H,13-15H2

|StdInChIKey = YGPLLMPPZRUGTJ-UHFFFAOYSA-N

|StdInChIKey_Ref =

}}

|Section2={{Chembox Properties

| C=27 | H=18

| Appearance =

| Density = 1.286 g/cm3

| MeltingPtC = 378

| MeltingPt_notes = Harper, William L.; Smith, Wesley E. Process for synthesizing truxene; amorphous or graphitic carbon from indenes. 1970. US 3504044 A.

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb =

}}

}}

Truxene is a polycyclic aromatic hydrocarbon. The molecule can be thought of as being made up of three fluorene units arranged symmetrically and sharing a common central benzene. Truxene is solid, and it is slightly soluble in water.

History

Truxene has been known since the end of the 19th century. J. Hausmann came across it in 1889 while investigating the reactions of 3-phenylpropionic acid with phosphorus pentoxide. He could not determine the exact structure but assumed it was a cyclic trimer of 1-indanone. According to him, it was formed by the condensation of 1-indanone resulting from intramolecular acylation of 3-phenylpropanoic acid.{{cite journal |last1=Hausmann |first1=J. |title=Einwirkung von o -Cyanbenzylchlorid auf Natriummalonester. Untersuchung des α-Hydrindons |journal=Berichte der Deutschen Chemischen Gesellschaft |date=July 1889 |volume=22 |issue=2 |pages=2019–2026 |doi=10.1002/cber.18890220264|url=https://zenodo.org/record/1425561 }}

Frederic Stanley Kipping was able to confirm the structure of truxene in 1894 and obtained the compound by the trimerization of 1-indanone.{{cite journal |last1=Kipping |first1=F. Stanley |title=XXIX. The formation of the hydrocarbon "truxene" from phenylpropionic acid, and from hydrindone |journal=J. Chem. Soc., Trans. |date=1894 |volume=65 |pages=269–290 |doi=10.1039/CT8946500269|url=https://zenodo.org/record/2186636 }}

Preparation

Truxene is prepared by the cyclotrimerization of 1-indanone in a mixture of acetic acid and concentrated hydrochloric acid. {{cite book |last=Amick |first=Aaron Warren |author-link= |date=2008 |title=Methodology Development for Use in Polycyclic Aromatic Hydrocarbon Synthesis |url=https://books.google.com/books?id=tzvKYexrQgkC |location= |publisher=PhD thesis |page=5 |isbn=978-0-549-75717-7}}

Uses

Truxene has a star shape, and it is therefore suitable as a starting point for the synthesis of dendrimers.{{cite journal |last1=Cao |first1=Xiao-Yu |last2=Zhang |first2=Wen-Bin |last3=Wang |first3=Jin-Liang |last4=Zhou |first4=Xing-Hua |last5=Lu |first5=Hua |last6=Pei |first6=Jian |title=Extended π-Conjugated Dendrimers Based on Truxene |journal=Journal of the American Chemical Society |date=1 October 2003 |volume=125 |issue=41 |pages=12430–12431 |doi=10.1021/ja037723d|pmid=14531685 }}

Derivatives of truxene have also been used for the synthesis of liquid crystals{{cite journal |last1=Destrade |first1=C. |last2=Gasparoux |first2=H. |last3=Babeau |first3=A. |last4=Tinh |first4=Nguyen Huu |last5=Malthete |first5=J. |title=Truxene Derivatives: A New Family of Disc-Like Liquid Crystals With an Inverted Nematic-Columnar Sequence |journal=Molecular Crystals and Liquid Crystals |date=May 1981 |volume=67 |issue=1 |pages=37–47 |doi=10.1080/00268948108070873}} and fragments of fullerene.{{cite journal |last1=Dehmlow |first1=Eckehard V. |last2=Kelle |first2=Torsten |title=Synthesis of New Truxene Derivatives: Possible Precursors of Fullerene Partial Structures? |journal=Synthetic Communications |date=June 1997 |volume=27 |issue=11 |pages=2021–2031 |doi=10.1080/00397919708006804}}

References