UCSF648

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = N-[(5-chloroquinolin-8-yl)methyl]-3-ethylsulfonylpropan-1-amine

| image = UCSF648.svg

| width =

| tradename =

| routes_of_administration =

| CAS_number = 2637090-56-1

| UNII =

| ATC_prefix =

| PubChem = 154864756

| IUPHAR_ligand =

| ChemSpiderID = 115008020

| ChEMBL = 5079940

| C=15 | H=19 | Cl=1 | N=2 | O=2 | S=1

| smiles = CCS(=O)(=O)CCCNCC1=C2C(=C(C=C1)Cl)C=CC=N2

| StdInChI = 1S/C15H19ClN2O2S/c1-2-21(19,20)10-4-8-17-11-12-6-7-14(16)13-5-3-9-18-15(12)13/h3,5-7,9,17H,2,4,8,10-11H2,1H3

| StdInChIKey = GNNSPXBPLMMQSR-UHFFFAOYSA-N

}}

UCSF648 is an experimental drug which acts as a selective partial agonist for the 5-HT_5A serotonin receptor. Very few selective ligands are available for this receptor, and UCSF648 is expected to be useful in researching its structure and function.{{cite journal | vauthors = Levit Kaplan A, Strachan RT, Braz JM, Craik V, Slocum S, Mangano T, Amabo V, O'Donnell H, Lak P, Basbaum AI, Roth BL, Shoichet BK | title = Structure-Based Design of a Chemical Probe Set for the 5-HT5A Serotonin Receptor | journal = Journal of Medicinal Chemistry | volume = 65 | issue = 5 | pages = 4201–4217 | date = March 2022 | pmid = 35195401 | pmc = 9116900 | doi = 10.1021/acs.jmedchem.1c02031 }}