Udenafil
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470619424
| IUPAC_name = 3-(1-Methyl-7-oxo-3-propyl-4,7-dihydro-1H-pyrazolo[4,3-d]pyrimidin-5-yl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-propoxybenzenesulfonamide
| image = Udenafil.svg
| width = 250
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US = Not approved
| legal_status = Rx-only
| routes_of_administration = By mouth
| bioavailability =
| protein_bound = 93,9%
| metabolism = Liver (mainly CYP3A4)
| elimination_half-life = 7.3–12.1 hours
| excretion = Biliary
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 268203-93-6
| ATC_prefix = G04
| ATC_suffix = BE11
| PubChem = 6918523
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB06267
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5293720
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = L5IB4XLY36
| KEGG = D10027
| KEGG_Ref = {{keggcite|changed|kegg}}
| C=25 | H=36 | N=6 | O=4 | S=1
| smiles = O=C2\N=C(/Nc1c(nn(c12)C)CCC)c3cc(ccc3OCCC)S(=O)(=O)NCCC4N(C)CCC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C25H36N6O4S/c1-5-8-20-22-23(31(4)29-20)25(32)28-24(27-22)19-16-18(10-11-21(19)35-15-6-2)36(33,34)26-13-12-17-9-7-14-30(17)3/h10-11,16-17,26H,5-9,12-15H2,1-4H3,(H,27,28,32)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = IYFNEFQTYQPVOC-UHFFFAOYSA-N
}}
The drug udenafil is marketed under the trade name Zydena. It is within the PDE5 inhibitor class (which also includes avanafil, sildenafil, tadalafil, and vardenafil). Like other PDE5 inhibitors, it is used to treat erectile dysfunction. Udenafil was developed by Dong-A Pharmaceutical.[https://archive.today/20130616101456/http://en.donga.co.kr/prd/prd01_view.jsp?mitgrp=FZYT Zydena (udenafil) product-information page.] Dong-A Pharmaceutical. Retrieved on April 13, 2009. It has fairly rapid onset of action (peak plasma concentration after 1 to 1.5 hours), and has long duration of action (plasma half-life of 11 to 13 hours). Udenafil's pharmacokinetics allows once-daily dosage (in addition to on-demand use).{{cite journal | vauthors = Kang SG, Kim JJ | title = Udenafil: efficacy and tolerability in the management of erectile dysfunction | journal = Therapeutic Advances in Urology | volume = 5 | issue = 2 | pages = 101–10 | date = April 2013 | pmid = 23554845 | pmc = 3607490 | doi = 10.1177/1756287212470019 }} Typical doses are 100 and 200 mg. Udenafil is available in Korea, Russia, and the Philippines.{{cite web | url = https://www.drugs.com/international/zydena.html | title = Zydena | work = Drugs.com }} It has not yet been approved for use in the United States by the U.S. Food and Drug Administration.
References
{{Reflist}}
{{Drugs for erectile dysfunction and PE}}
{{Phosphodiesterase inhibitors}}
{{genito-urinary-drug-stub}}