Ulobetasol

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 470619490

| image = Ulobetasol.svg

| USAN = halobetasol

| tradename = Ultravate

| Drugs.com = {{drugs.com|ppa|halobetasol}}

| MedlinePlus = a601060

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 98651-66-2

| ATC_prefix = D07

| ATC_suffix = AC21

| ATC_supplemental =
{{ATC|D05|AX55}} (combination with tazarotene)

| PubChem = 5311167

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4470691

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 9P6159HM7T

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D08660

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201360

| IUPAC_name = (6α,11β,16β)-21-Chloro-6,9-difluoro-11,17-dihydroxy-16-methylpregna-1,4-diene-3,20-dione

| C=22 | H=27 | Cl=1 | F=2 | O=4

| smiles = ClCC(=O)[C@]3(O)[C@]2(C[C@H](O)[C@]4(F)[C@@]/1(\C(=C/C(=O)\C=C\1)[C@@H](F)C[C@H]4[C@@H]2C[C@@H]3C)C)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H27ClF2O4/c1-11-6-13-14-8-16(24)15-7-12(26)4-5-19(15,2)21(14,25)17(27)9-20(13,3)22(11,29)18(28)10-23/h4-5,7,11,13-14,16-17,27,29H,6,8-10H2,1-3H3/t11-,13-,14-,16-,17-,19-,20-,21-,22-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LEHFPXVYPMWYQD-XHIJKXOTSA-N

| synonyms = (6S,8S,9S,10S,11S,13S,14S,16S,17R)-17-(2-Chloroacetyl)-6,9-difluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one

}}

Ulobetasol (INN) or halobetasol (USAN) is a corticosteroid used to treat psoriasis.{{cite web|url=https://pdf.hres.ca/dpd_pm/00053569.PDF|title=Ultravate product monograph|access-date=2021-01-04}}{{DrugBank|DB00596}}. Retrieved 2020-01-04. It is a class I corticosteroid under the US classification and a group III corticosteroid under international classification, the most potent group of such drugs.{{cite journal | vauthors = Pearce DJ, Spencer L, Hu J, Balkrishnan R, Fleischer AB, Feldman SR | title = Class I topical corticosteroid use by psoriasis patients in an academic practice | journal = The Journal of Dermatological Treatment | volume = 15 | issue = 4 | pages = 235–8 | date = July 2004 | pmid = 15764038 | doi = 10.1080/09546630410033745 | s2cid = 2757493 }}ATC code {{ATC|D07|AC21}}. Retrieved 2020-01-04.

Ulobetasol propionate is usually supplied as a 0.05% topical cream. Ulobetasol is the strongest topical steroid available.{{cn|date=February 2017}} It is also sold with tazarotene with 0.01% halobetasol and 0.045% tazarotene as a lotion branded as Duobrii (Bausch Health).

It is available as a generic medication.{{cite web | title=Ulobetasol international | website=Drugs.com | date=10 August 2020 | url=https://www.drugs.com/international/ulobetasol.html | access-date=15 August 2020}}