Uranyl oxalate

{{Chembox

|Name = Uranyl oxalate

|ImageFile = U Oxalate Trihydrate.tif

|OtherNames = Uranyl oxalate trihydrate; uranyl oxalate hydrate

|Section1 = {{Chembox Identifiers

|CASNo = 2031-89-2

|ChemSpiderID = 11588161

|PubChem = 22717423

|StdInChI=1S/C2H2O4.2O.U/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;;/q;;;+2/p-2

|StdInChIKey = PRWGGWFEEGTKSV-UHFFFAOYSA-L

|SMILES = C(=O)(C(=O)[O-])[O-].O=[U+2]=O

}}

|Section2 = {{Chembox Properties

|Formula = UO₂C₂O₄

|MolarMass = 358 g/mole (412 g/mol as trihydrate)

|Appearance = Pale yellow powder

|Solubility = Partially soluble

}}

|Section3 = {{Chembox Related

|OtherFunction = Uranyl peroxide
Triuranium octoxide
Uranium dioxide

|OtherFunction_label = uranium oxides

}}

}}

Uranyl oxalate (UO₂C₂O₄) is a pale yellow powdered uranyl salt. It is often encountered in industrial nuclear processes at both the front and back-end of the nuclear fuel cycle. Due to its hygroscopicity, uranyl oxalate rarely exists in the dehydrated state and is usually instead found in the trihydrate form (UO₂C₂O₄·3H₂O) at room temperature.{{Cite journal |last=Thompson |first=Nathan B. A. |last2=Stennett |first2=Martin C. |last3=Gilbert |first3=Matthew R. |last4=Hyatt |first4=Neil C. |date=2021-01-06 |title=Nuclear forensic signatures and structural analysis of uranyl oxalate, its products of thermal decomposition and Fe impurity dopant |journal=Journal of Radioanalytical and Nuclear Chemistry |volume=327 |issue=2 |pages=957–973 |doi=10.1007/s10967-020-07538-2 |issn=0236-5731 |doi-access=free}} At room temperature, the powder exhibits a monoclinic crystal structure in the P2₁/c space group.{{Cite journal |last=Jayadevan |first=N. C. |last2=Chackraburtty |first2=D. M. |date=1972-11-15 |title=The crystal and molecular structure of uranyl oxalate trihydrate |journal=Acta Crystallographica Section B: Structural Crystallography and Crystal Chemistry |volume=28 |issue=11 |pages=3178–3182 |bibcode=1972AcCrB..28.3178J |doi=10.1107/s0567740872007691 |issn=0567-7408}}