User:Calmkelp/sandbox
{{infobox drug
| image = Furazidine.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class =
| ATC_prefix =
| ATC_suffix =
| drug_name =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 1672-88-4
| CAS_supplemental =
| PubChem = 6870646
| IUPHAR_ligand =
| DrugBank = DB13475
| ChemSpiderID =
| UNII = K2R4N34Y9I
| KEGG = D07998
| ChEBI =
| ChEMBL = 3707254
| NIAID_ChemDB =
| PDB_ligand =
| IUPAC_name = 1-[(E)-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]amino]imidazolidine-2,4-dione
| C=10 | H=8 | N=4 | O=5
| SMILES = C1C(=O)NC(=O)N1/N=C/C=C/C2=CC=C(O2)[N+](=O)[O-]
| StdInChI = 1S/C10H8N4O5/c15-8-6-13(10(16)12-8)11-5-1-2-7-3-4-9(19-7)14(17)18/h1-5H,6H2,(H,12,15,16)/b2-1+,11-5+
| StdInChIKey = DECBQELQORZLLP-UAIOPKHMSA-N}}
Furazidine, also known as furazidin or furagin, is a synthetic antibiotic belonging to the nitrofuran class. It primarily acts as a bacteriostatic agent, inhibiting the growth of a broad range of Gram-positive and Gram-negative bacteria.
Furazidin is mainly used to treat urinary tract infections (UTIs), particularly those affecting the lower urinary tract. It has also been used in the treatment of certain skin and soft tissue infections.